Difference between revisions of "CPD-714"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-313 CPD-313] == * smiles: ** C(CC[N+])[N+] * inchi key: ** InChIKey=XFNJVJPLKCPIBV-UHFFFAOY...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] == |
* smiles: | * smiles: | ||
| − | ** C(CC[ | + | ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
| + | * molecular weight: | ||
| + | ** 432.685 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N |
* common name: | * common name: | ||
| − | ** | + | ** cathasterone |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-715]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | * | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=23057 23057] | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15341086 15341086] |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15790 C15790] |
| − | + | {{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | |
| − | + | {{#set: molecular weight=432.685 }} | |
| − | + | {{#set: inchi key=InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N}} | |
| − | + | {{#set: common name=cathasterone}} | |
| − | + | {{#set: produced by=RXN-715}} | |
| − | {{#set: smiles=C(CC[ | + | |
| − | + | ||
| − | + | ||
| − | {{#set: molecular weight= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:24, 9 January 2019
Contents
Metabolite CPD-714
- smiles:
- CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- molecular weight:
- 432.685
- inchi key:
- InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N
- common name:
- cathasterone
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
