Difference between revisions of "2.7.11.2-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] == * smiles: ** C(=O)([O-])C=CC1(=CC=CC=C1) * inchi key: ** InChIKey=WBYWAXJHA...") |
|||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.11.2-RXN 2.7.11.2-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** probable pyruvate dehydrogenase kinase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.11.2 EC-2.7.11.2] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[Pyruvate-dehydrogenases]][c] '''+''' 1 [[ATP]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[Phosphorylated-pyruvate-dehydrogenases]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 a pyruvate dehydrogenase[c] '''+''' 1 ATP[c] '''<=>''' 1 ADP[c] '''+''' 1 a phosphorylated pyruvate dehydrogenase[c] |
− | == | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
+ | * Gene: [[CHC_T00006845001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00008298001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00008298001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03449 R03449] | |
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=probable pyruvate dehydrogenase kinase}} | |
− | + | {{#set: ec number=EC-2.7.11.2}} | |
− | * LIGAND- | + | {{#set: gene associated=CHC_T00006845001_1|CHC_T00008298001_1|CHC_T00008298001}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=}} |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:24, 9 January 2019
Contents
Reaction 2.7.11.2-RXN
- direction:
- REVERSIBLE
- common name:
- probable pyruvate dehydrogenase kinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Pyruvate-dehydrogenases[c] + 1 ATP[c] <=> 1 ADP[c] + 1 Phosphorylated-pyruvate-dehydrogenases[c]
- With common name(s):
- 1 a pyruvate dehydrogenase[c] + 1 ATP[c] <=> 1 ADP[c] + 1 a phosphorylated pyruvate dehydrogenase[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00006845001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00008298001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00008298001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome
External links
- LIGAND-RXN: