Difference between revisions of "PWY-7198"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLACETATE PHENYLACETATE] == * smiles: ** C1(=CC=C(C=C1)CC([O-])=O) * inchi key: ** InChIKey...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7198 PWY-7198] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** pyrimidine deoxyribonucleotides de novo biosynthesis IV |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''6''' reactions found over '''7''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[CDPREDUCT-RXN]] |
− | * [ | + | ** 4 associated gene(s): |
+ | *** [[CHC_T00008864001_1]] | ||
+ | *** [[CHC_T00008864001]] | ||
+ | *** [[CHC_T00008926001]] | ||
+ | *** [[CHC_T00008926001_1]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[DCDPKIN-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[CHC_T00009258001_1]] | ||
+ | *** [[CHC_T00009233001]] | ||
+ | *** [[CHC_T00009258001]] | ||
+ | *** [[CHC_T00009233001_1]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[DTDPKIN-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[CHC_T00009233001_1]] | ||
+ | *** [[CHC_T00009258001_1]] | ||
+ | *** [[CHC_T00009258001]] | ||
+ | *** [[CHC_T00009233001]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[DTMPKI-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00002059001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RXN-12195]] | ||
+ | ** 7 associated gene(s): | ||
+ | *** [[CHC_T00001236001_1]] | ||
+ | *** [[CHC_T00010157001_1]] | ||
+ | *** [[CHC_T00004941001_1]] | ||
+ | *** [[CHC_T00000060001_1]] | ||
+ | *** [[CHC_T00007176001_1]] | ||
+ | *** [[CHC_T00005746001_1]] | ||
+ | *** [[CHC_T00006198001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[THYMIDYLATESYN-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00010030001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=3.5.4.30-RXN 3.5.4.30-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=pyrimidine deoxyribonucleotides de novo biosynthesis IV}} | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: reaction found=6}} | |
− | + | {{#set: total reaction=7}} | |
− | + | {{#set: completion rate=86.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 15:26, 9 January 2019
Pathway PWY-7198
- common name:
- pyrimidine deoxyribonucleotides de novo biosynthesis IV
- taxonomic range:
- Synonym(s):
Reaction(s) found
6 reactions found over 7 reactions in the full pathway
- CDPREDUCT-RXN
- 4 associated gene(s):
- 4 reconstruction source(s) associated:
- DCDPKIN-RXN
- 4 associated gene(s):
- 4 reconstruction source(s) associated:
- DTDPKIN-RXN
- 4 associated gene(s):
- 4 reconstruction source(s) associated:
- DTMPKI-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-12195
- 7 associated gene(s):
- 2 reconstruction source(s) associated:
- THYMIDYLATESYN-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated: