Difference between revisions of "PWY-7198"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLACETATE PHENYLACETATE] == * smiles: ** C1(=CC=C(C=C1)CC([O-])=O) * inchi key: ** InChIKey...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLACETATE PHENYLACETATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7198 PWY-7198] ==
* smiles:
+
** C1(=CC=C(C=C1)CC([O-])=O)
+
* inchi key:
+
** InChIKey=WLJVXDMOQOGPHL-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** phenylacetate
+
** pyrimidine deoxyribonucleotides de novo biosynthesis IV
* molecular weight:
+
* taxonomic range:
** 135.142   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 
* Synonym(s):
 
* Synonym(s):
** 2-phenylacetate
 
** benzeneacetic acid
 
** phenylacetic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''6''' reactions found over '''7''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[CDPREDUCT-RXN]]
* [[PHENDEHYD-RXN]]
+
** 4 associated gene(s):
 +
*** [[CHC_T00008864001_1]]
 +
*** [[CHC_T00008864001]]
 +
*** [[CHC_T00008926001]]
 +
*** [[CHC_T00008926001_1]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[DCDPKIN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00009258001_1]]
 +
*** [[CHC_T00009233001]]
 +
*** [[CHC_T00009258001]]
 +
*** [[CHC_T00009233001_1]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[DTDPKIN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00009233001_1]]
 +
*** [[CHC_T00009258001_1]]
 +
*** [[CHC_T00009258001]]
 +
*** [[CHC_T00009233001]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[DTMPKI-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00002059001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-12195]]
 +
** 7 associated gene(s):
 +
*** [[CHC_T00001236001_1]]
 +
*** [[CHC_T00010157001_1]]
 +
*** [[CHC_T00004941001_1]]
 +
*** [[CHC_T00000060001_1]]
 +
*** [[CHC_T00007176001_1]]
 +
*** [[CHC_T00005746001_1]]
 +
*** [[CHC_T00006198001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[THYMIDYLATESYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00010030001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=3.5.4.30-RXN 3.5.4.30-RXN]
 
== External links  ==
 
== External links  ==
* CAS : 103-82-2
+
{{#set: common name=pyrimidine deoxyribonucleotides de novo biosynthesis IV}}
* Wikipedia : Phenylacetic_acid
+
{{#set: taxonomic range=TAX-2157}}
* METABOLIGHTS : MTBLC18401
+
{{#set: reaction found=6}}
* PUBCHEM:
+
{{#set: total reaction=7}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4409936 4409936]
+
{{#set: completion rate=86.0}}
* HMDB : HMDB00209
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C07086 C07086]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.3610724.html 3610724]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18401 18401]
+
* BIGG : pac
+
{{#set: smiles=C1(=CC=C(C=C1)CC([O-])=O)}}
+
{{#set: inchi key=InChIKey=WLJVXDMOQOGPHL-UHFFFAOYSA-M}}
+
{{#set: common name=phenylacetate}}
+
{{#set: molecular weight=135.142    }}
+
{{#set: common name=2-phenylacetate|benzeneacetic acid|phenylacetic acid}}
+
{{#set: consumed or produced by=PHENDEHYD-RXN}}
+

Latest revision as of 15:26, 9 January 2019

Pathway PWY-7198

  • common name:
    • pyrimidine deoxyribonucleotides de novo biosynthesis IV
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

6 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links