Difference between revisions of "CPD-7224"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-3-4-TRIPHOSPHATE INOSITOL-1-3-4-TRIPHOSPHATE] == * smiles: ** C1(O)(C(O)C(OP(=O)([O-...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7224 CPD-7224] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(=O)NC(C([O-])=O)CCCNC(=O)N |
| + | * molecular weight: | ||
| + | ** 216.216 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=WMQMIOYQXNRROC-LURJTMIESA-M |
* common name: | * common name: | ||
| − | ** | + | ** N-acetyl-L-citrulline |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** acetyl-citrulline |
| − | ** | + | ** N5-acetylcarbamoyl-L-ornithine |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-7933]] | |
| − | * [[RXN- | + | |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58765 58765] |
| − | + | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266759 45266759] |
| − | * HMDB : | + | * LIGAND-CPD: |
| − | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15532 C15532] |
| − | {{#set: | + | * HMDB : HMDB00856 |
| − | {{#set: | + | {{#set: smiles=CC(=O)NC(C([O-])=O)CCCNC(=O)N}} |
| − | + | {{#set: molecular weight=216.216 }} | |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=WMQMIOYQXNRROC-LURJTMIESA-M}} |
| − | {{#set: | + | {{#set: common name=N-acetyl-L-citrulline}} |
| − | {{#set: | + | {{#set: common name=acetyl-citrulline|N5-acetylcarbamoyl-L-ornithine}} |
| + | {{#set: consumed by=RXN-7933}} | ||
Latest revision as of 15:26, 9 January 2019
Contents
Metabolite CPD-7224
- smiles:
- CC(=O)NC(C([O-])=O)CCCNC(=O)N
- molecular weight:
- 216.216
- inchi key:
- InChIKey=WMQMIOYQXNRROC-LURJTMIESA-M
- common name:
- N-acetyl-L-citrulline
- Synonym(s):
- acetyl-citrulline
- N5-acetylcarbamoyl-L-ornithine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)NC(C([O-])=O)CCCNC(=O)N" cannot be used as a page name in this wiki.
