Difference between revisions of "PWY-6894"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXYBENZALDEHYDE 4-HYDROXYBENZALDEHYDE] == * smiles: ** [CH](C1(C=CC(O)=CC=1))=O * inchi k...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXYBENZALDEHYDE 4-HYDROXYBENZALDEHYDE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6894 PWY-6894] ==
* smiles:
+
** [CH](C1(C=CC(O)=CC=1))=O
+
* inchi key:
+
** InChIKey=RGHHSNMVTDWUBI-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 4-hydroxybenzaldehyde
+
** thiamine diphosphate biosynthesis I (E. coli)
* molecular weight:
+
* taxonomic range:
** 122.123   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
** p-hydroxybenzaldehyde
+
** vitamin B1 biosynthesis
 +
** thiamin diphosphate biosynthesis I (E. coli)
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-8872]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-12611]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[CHC_T00006435001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=THI-P-KIN-RXN THI-P-KIN-RXN]
 
== External links  ==
 
== External links  ==
* CAS : 123-08-0
+
* ECOCYC:
* DRUGBANK : DB03560
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6894 PWY-6894]
* PUBCHEM:
+
{{#set: common name=thiamine diphosphate biosynthesis I (E. coli)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=126 126]
+
{{#set: taxonomic range=TAX-2}}
* HMDB : HMDB11718
+
{{#set: common name=vitamin B1 biosynthesis|thiamin diphosphate biosynthesis I (E. coli)}}
* LIGAND-CPD:
+
{{#set: reaction found=1}}
** [http://www.genome.jp/dbget-bin/www_bget?C00633 C00633]
+
{{#set: total reaction=2}}
* CHEMSPIDER:
+
{{#set: completion rate=50.0}}
** [http://www.chemspider.com/Chemical-Structure.123.html 123]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17597 17597]
+
* METABOLIGHTS : MTBLC17597
+
{{#set: smiles=[CH](C1(C=CC(O)=CC=1))=O}}
+
{{#set: inchi key=InChIKey=RGHHSNMVTDWUBI-UHFFFAOYSA-N}}
+
{{#set: common name=4-hydroxybenzaldehyde}}
+
{{#set: molecular weight=122.123    }}
+
{{#set: common name=p-hydroxybenzaldehyde}}
+
{{#set: consumed by=RXN-8872}}
+

Latest revision as of 15:27, 9 January 2019

Pathway PWY-6894

  • common name:
    • thiamine diphosphate biosynthesis I (E. coli)
  • taxonomic range:
  • Synonym(s):
    • vitamin B1 biosynthesis
    • thiamin diphosphate biosynthesis I (E. coli)

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links