Difference between revisions of "CPD-8848"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=mature-tRNA mature-tRNA] == * common name: ** mature tRNA * Synonym(s): == Reaction(s) known t...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8848 CPD-8848] == |
+ | * smiles: | ||
+ | ** C=CC(CCC=C(CCC=C(CCC=C(C)C)C)C)(C)O | ||
+ | * molecular weight: | ||
+ | ** 290.488 | ||
+ | * inchi key: | ||
+ | ** InChIKey=IQDXAJNQKSIPGB-HQSZAHFGSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** (E,E)-geranyllinalool |
* Synonym(s): | * Synonym(s): | ||
+ | ** (6E,10E)-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-ol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-8620]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-10441]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74299 74299] |
+ | * METABOLIGHTS : MTBLC74299 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5365872 5365872] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C20681 C20681] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4517814.html 4517814] | ||
+ | {{#set: smiles=C=CC(CCC=C(CCC=C(CCC=C(C)C)C)C)(C)O}} | ||
+ | {{#set: molecular weight=290.488 }} | ||
+ | {{#set: inchi key=InChIKey=IQDXAJNQKSIPGB-HQSZAHFGSA-N}} | ||
+ | {{#set: common name=(E,E)-geranyllinalool}} | ||
+ | {{#set: common name=(6E,10E)-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-ol}} | ||
+ | {{#set: consumed by=RXN-8620}} | ||
+ | {{#set: produced by=RXN-10441}} |
Latest revision as of 15:27, 9 January 2019
Contents
Metabolite CPD-8848
- smiles:
- C=CC(CCC=C(CCC=C(CCC=C(C)C)C)C)(C)O
- molecular weight:
- 290.488
- inchi key:
- InChIKey=IQDXAJNQKSIPGB-HQSZAHFGSA-N
- common name:
- (E,E)-geranyllinalool
- Synonym(s):
- (6E,10E)-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links