Difference between revisions of "5-DIPHOSPHO-1D-MYO-INOSITOL-12346P"
From metabolic_network
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-DIPHOSPHO-1D-MYO-INOSITOL-12346P 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P] == |
− | * | + | * smiles: |
− | ** [ | + | ** C1(OP([O-])([O-])=O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1) |
+ | * molecular weight: | ||
+ | ** 726.913 | ||
+ | * inchi key: | ||
+ | ** InChIKey=UPHPWXPNZIOZJL-KXXVROSKSA-A | ||
* common name: | * common name: | ||
− | ** | + | ** 1D-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate |
* Synonym(s): | * Synonym(s): | ||
+ | ** 5-PP-InsP5 | ||
+ | ** diphosphoinositol pentakisphosphate | ||
+ | ** 5-diphospho-1D-myo-inositol pentakisphosphate | ||
+ | ** (1r,2R,3S,4s,5R,6S)-2,3,4,5,6-pentakis(phosphonooxy)cyclohexyl trihydrogen diphosphate | ||
+ | ** 5-diphospho-1D-myo-inositol 1,2,3,4,6-pentakisphosphate | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[2.7.1.152-RXN]] | |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
− | * [ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58628 58628] |
− | {{#set: | + | * METABOLIGHTS : MTBLC30164 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201153 25201153] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C11526 C11526] | ||
+ | * HMDB : HMDB06229 | ||
+ | {{#set: smiles=C1(OP([O-])([O-])=O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)}} | ||
+ | {{#set: molecular weight=726.913 }} | ||
+ | {{#set: inchi key=InChIKey=UPHPWXPNZIOZJL-KXXVROSKSA-A}} | ||
+ | {{#set: common name=1D-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate}} | ||
+ | {{#set: common name=5-PP-InsP5|diphosphoinositol pentakisphosphate|5-diphospho-1D-myo-inositol pentakisphosphate|(1r,2R,3S,4s,5R,6S)-2,3,4,5,6-pentakis(phosphonooxy)cyclohexyl trihydrogen diphosphate|5-diphospho-1D-myo-inositol 1,2,3,4,6-pentakisphosphate}} | ||
+ | {{#set: produced by=2.7.1.152-RXN}} |
Latest revision as of 16:28, 9 January 2019
Contents
Metabolite 5-DIPHOSPHO-1D-MYO-INOSITOL-12346P
- smiles:
- C1(OP([O-])([O-])=O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)
- molecular weight:
- 726.913
- inchi key:
- InChIKey=UPHPWXPNZIOZJL-KXXVROSKSA-A
- common name:
- 1D-myoinositol 5-diphosphate 1,2,3,4,6-pentakisphosphate
- Synonym(s):
- 5-PP-InsP5
- diphosphoinositol pentakisphosphate
- 5-diphospho-1D-myo-inositol pentakisphosphate
- (1r,2R,3S,4s,5R,6S)-2,3,4,5,6-pentakis(phosphonooxy)cyclohexyl trihydrogen diphosphate
- 5-diphospho-1D-myo-inositol 1,2,3,4,6-pentakisphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(OP([O-])([O-])=O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)" cannot be used as a page name in this wiki.