Difference between revisions of "O-SUCCINYL-L-HOMOSERINE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00010004001_1 == * Synonym(s): == Reactions associated == * 1.14.13.78-RXN ** pantograph-a.taliana * RXN-1121 ** pantograph...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] == |
| + | * smiles: | ||
| + | ** C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O | ||
| + | * molecular weight: | ||
| + | ** 218.186 | ||
| + | * inchi key: | ||
| + | ** InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M | ||
| + | * common name: | ||
| + | ** O-succinyl-L-homoserine | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** O-succinyl-homoserine | ||
| + | ** succinyl-homoserine | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[METBALT-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[ | + | * [[HOMSUCTRAN-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[O-SUCCHOMOSERLYASE-RXN]] | |
| − | + | * [[RXN-9384]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * CHEBI: | |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57661 57661] |
| + | * CAS : 1492-23-5 | ||
| + | * BIGG : suchms | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878420 46878420] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01118 C01118] | ||
| + | {{#set: smiles=C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O}} | ||
| + | {{#set: molecular weight=218.186 }} | ||
| + | {{#set: inchi key=InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M}} | ||
| + | {{#set: common name=O-succinyl-L-homoserine}} | ||
| + | {{#set: common name=O-succinyl-homoserine|succinyl-homoserine}} | ||
| + | {{#set: consumed by=METBALT-RXN}} | ||
| + | {{#set: produced by=HOMSUCTRAN-RXN}} | ||
| + | {{#set: reversible reaction associated=O-SUCCHOMOSERLYASE-RXN|RXN-9384}} | ||
Latest revision as of 15:28, 9 January 2019
Contents
Metabolite O-SUCCINYL-L-HOMOSERINE
- smiles:
- C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O
- molecular weight:
- 218.186
- inchi key:
- InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M
- common name:
- O-succinyl-L-homoserine
- Synonym(s):
- O-succinyl-homoserine
- succinyl-homoserine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O" cannot be used as a page name in this wiki.
