Difference between revisions of "CHC 615"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] == * smiles: ** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1) * inchi key: ** InChIKe...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] ==
+
== Gene CHC_615 ==
* smiles:
+
** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)
+
* inchi key:
+
** InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** 2-carboxy-L-xylonolactone
+
** psbK
* molecular weight:
+
* left end position:
** 191.117    
+
** 85117
 +
* transcription direction:
 +
** POSITIVE
 +
* right end position:
 +
** 85254
 +
* centisome position:
 +
** 47.26464    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-12871]]
+
* Reaction: [[PSII-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-original_genome]]
* [[RXN-12870]]
+
*** Assignment: automated-name-match
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-101]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=psbK}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658445 90658445]
+
{{#set: left end position=85117}}
{{#set: smiles=C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)}}
+
{{#set: transcription direction=POSITIVE}}
{{#set: inchi key=InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M}}
+
{{#set: right end position=85254}}
{{#set: common name=2-carboxy-L-xylonolactone}}
+
{{#set: centisome position=47.26464   }}
{{#set: molecular weight=191.117   }}
+
{{#set: reaction associated=PSII-RXN}}
{{#set: consumed by=RXN-12871}}
+
{{#set: pathway associated=PWY-101}}
{{#set: produced by=RXN-12870}}
+

Latest revision as of 15:29, 9 January 2019

Gene CHC_615

  • common name:
    • psbK
  • left end position:
    • 85117
  • transcription direction:
    • POSITIVE
  • right end position:
    • 85254
  • centisome position:
    • 47.26464
  • Synonym(s):

Reactions associated

Pathways associated

External links