Difference between revisions of "CHC 615"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] == * smiles: ** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1) * inchi key: ** InChIKe...") |
|||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_615 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** psbK |
− | * | + | * left end position: |
− | ** | + | ** 85117 |
+ | * transcription direction: | ||
+ | ** POSITIVE | ||
+ | * right end position: | ||
+ | ** 85254 | ||
+ | * centisome position: | ||
+ | ** 47.26464 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[PSII-RXN]] |
− | == | + | ** Source: [[annotation-original_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | + | == Pathways associated == | |
+ | * [[PWY-101]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=psbK}} | |
− | + | {{#set: left end position=85117}} | |
− | {{#set: | + | {{#set: transcription direction=POSITIVE}} |
− | {{#set: | + | {{#set: right end position=85254}} |
− | {{#set: | + | {{#set: centisome position=47.26464 }} |
− | {{#set: | + | {{#set: reaction associated=PSII-RXN}} |
− | {{#set: | + | {{#set: pathway associated=PWY-101}} |
− | {{#set: | + |
Latest revision as of 15:29, 9 January 2019
Gene CHC_615
- common name:
- psbK
- left end position:
- 85117
- transcription direction:
- POSITIVE
- right end position:
- 85254
- centisome position:
- 47.26464
- Synonym(s):
Reactions associated
- Reaction: PSII-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome