Difference between revisions of "CPD-8646"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00004712001_1 == * Synonym(s): == Reactions associated == * GLUTATHIONE-REDUCT-NADPH-RXN ** pantograph-galdieria.sulphuraria ** p...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00004712001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] ==
 +
* smiles:
 +
** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))
 +
* molecular weight:
 +
** 382.628   
 +
* inchi key:
 +
** InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N
 +
* common name:
 +
** 7-dehydrodesmosterol
 
* Synonym(s):
 
* Synonym(s):
 +
** 5α-cholesta-5,7,24-trien-3β-ol
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
+
* [[RXN66-27]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[a.taliana]]
+
* [[RXN-11887]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-4081]]
+
* [[GLUT-REDOX-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=GLUTATHIONE-REDUCT-NADPH-RXN}}
+
* CHEBI:
{{#set: pathway associated=PWY-4081|GLUT-REDOX-PWY}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27910 27910]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440558 440558]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05107 C05107]
 +
* HMDB : HMDB03896
 +
{{#set: smiles=CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))}}
 +
{{#set: molecular weight=382.628    }}
 +
{{#set: inchi key=InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N}}
 +
{{#set: common name=7-dehydrodesmosterol}}
 +
{{#set: common name=5α-cholesta-5,7,24-trien-3β-ol}}
 +
{{#set: consumed by=RXN66-27}}
 +
{{#set: produced by=RXN-11887}}

Latest revision as of 15:29, 9 January 2019

Metabolite CPD-8646

  • smiles:
    • CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))
  • molecular weight:
    • 382.628
  • inchi key:
    • InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N
  • common name:
    • 7-dehydrodesmosterol
  • Synonym(s):
    • 5α-cholesta-5,7,24-trien-3β-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))" cannot be used as a page name in this wiki.