Difference between revisions of "PWY-6955"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * smiles: ** C12(NC(=O)NC=1C(=O)NC(=O)N2) * inchi key: ** InChIKey=LEHOTFFKMJEO...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6955 PWY-6955] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** lincomycin biosynthesis |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''8''' reactions in the full pathway |
− | + | * [[RXN-5861]] | |
− | * [[ | + | ** 1 associated gene(s): |
− | == Reaction(s) | + | *** [[CHC_T00005217001_1]] |
− | * [[ | + | ** 2 reconstruction source(s) associated: |
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12851 RXN-12851] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12852 RXN-12852] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12854 RXN-12854] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12855 RXN-12855] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12859 RXN-12859] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12860 RXN-12860] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=STIZOLOBINATE-SYNTHASE-RXN STIZOLOBINATE-SYNTHASE-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=lincomycin biosynthesis}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=8}} | |
− | + | {{#set: completion rate=12.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 15:29, 9 January 2019
Pathway PWY-6955
- common name:
- lincomycin biosynthesis
- taxonomic range:
- Synonym(s):
Reaction(s) found
1 reactions found over 8 reactions in the full pathway
- RXN-5861
- 1 associated gene(s):
- 2 reconstruction source(s) associated: