Difference between revisions of "CPD-18550"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00010264001_1 == * Synonym(s): == Reactions associated == * RXN-11109 ** pantograph-galdieria.sulphuraria == Pathways associated ==...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == |
+ | * smiles: | ||
+ | ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O | ||
+ | * molecular weight: | ||
+ | ** 502.359 | ||
+ | * inchi key: | ||
+ | ** InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M | ||
+ | * common name: | ||
+ | ** quinoxaline-2-carboxyl adenylate | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | * [[RXN-17155]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515331 102515331] | ||
+ | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O}} | ||
+ | {{#set: molecular weight=502.359 }} | ||
+ | {{#set: inchi key=InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M}} | ||
+ | {{#set: common name=quinoxaline-2-carboxyl adenylate}} | ||
+ | {{#set: consumed by=RXN-17155}} |
Latest revision as of 15:29, 9 January 2019
Contents
Metabolite CPD-18550
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O
- molecular weight:
- 502.359
- inchi key:
- InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M
- common name:
- quinoxaline-2-carboxyl adenylate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O" cannot be used as a page name in this wiki.