Difference between revisions of "CPD-7061"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETATE--COA-LIGASE-RXN ACETATE--COA-LIGASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: **...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETATE--COA-LIGASE-RXN ACETATE--COA-LIGASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7061 CPD-7061] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6))))))
 +
* molecular weight:
 +
** 590.677   
 +
* inchi key:
 +
** InChIKey=UXWYEAZHZLZDGM-ZVEVZSNKSA-M
 
* common name:
 
* common name:
−
** acetyl-CoA synthetase
+
** pheophorbide a
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/6.2.1.1 EC-6.2.1.1]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** pheide a
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7740]]
−
** 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[ACET]][c] '''=>''' 1 [[ACETYL-COA]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c]
+
* [[RXN-17252]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 ATP[c] '''+''' 1 coenzyme A[c] '''+''' 1 acetate[c] '''=>''' 1 acetyl-CoA[c] '''+''' 1 AMP[c] '''+''' 1 diphosphate[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008320001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
* [[CHC_T00008320001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY66-161]], ethanol degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-161 PWY66-161]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY66-21]], ethanol degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-21 PWY66-21]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY66-162]], ethanol degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-162 PWY66-162]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY0-1313]], acetate conversion to acetyl-CoA: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1313 PWY0-1313]
+
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
−
* [[PWY-6672]], cis-genanyl-CoA degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6672 PWY-6672]
+
−
** '''2''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-7118]], chitin degradation to ethanol: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7118 PWY-7118]
+
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CHEBI:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23176 23176]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58687 58687]
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00235 R00235]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658422 90658422]
−
* UNIPROT:
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/P27095 P27095]
+
** [http://www.genome.jp/dbget-bin/www_bget?C18021 C18021]
−
** [http://www.uniprot.org/uniprot/P31638 P31638]
+
* CHEMSPIDER:
−
** [http://www.uniprot.org/uniprot/Q12662 Q12662]
+
** [http://www.chemspider.com/Chemical-Structure.4481064.html 4481064]
−
** [http://www.uniprot.org/uniprot/P28812 P28812]
+
{{#set: smiles=C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6))))))}}
−
** [http://www.uniprot.org/uniprot/P27550 P27550]
+
{{#set: molecular weight=590.677    }}
−
** [http://www.uniprot.org/uniprot/O34613 O34613]
+
{{#set: inchi key=InChIKey=UXWYEAZHZLZDGM-ZVEVZSNKSA-M}}
−
** [http://www.uniprot.org/uniprot/Q9PMD2 Q9PMD2]
+
{{#set: common name=pheophorbide a}}
−
** [http://www.uniprot.org/uniprot/P36333 P36333]
+
{{#set: common name=pheide a}}
−
** [http://www.uniprot.org/uniprot/Q01574 Q01574]
+
{{#set: consumed by=RXN-7740|RXN-17252}}
−
** [http://www.uniprot.org/uniprot/P39062 P39062]
+
−
** [http://www.uniprot.org/uniprot/Q01576 Q01576]
+
−
** [http://www.uniprot.org/uniprot/P52910 P52910]
+
−
** [http://www.uniprot.org/uniprot/Q55404 Q55404]
+
−
** [http://www.uniprot.org/uniprot/P16928 P16928]
+
−
** [http://www.uniprot.org/uniprot/P16929 P16929]
+
−
** [http://www.uniprot.org/uniprot/O68040 O68040]
+
−
** [http://www.uniprot.org/uniprot/P78773 P78773]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: common name=acetyl-CoA synthetase}}
+
−
{{#set: ec number=EC-6.2.1.1}}
+
−
{{#set: gene associated=CHC_T00008320001_1|CHC_T00008320001}}
+
−
{{#set: in pathway=PWY66-161|PWY66-21|PWY66-162|PWY0-1313|PWY-6672|PWY-7118}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=original_genome}}
+

Latest revision as of 15:29, 9 January 2019

Metabolite CPD-7061

  • smiles:
    • C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6))))))
  • molecular weight:
    • 590.677
  • inchi key:
    • InChIKey=UXWYEAZHZLZDGM-ZVEVZSNKSA-M
  • common name:
    • pheophorbide a
  • Synonym(s):
    • pheide a

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC5(=C(C)C6(=CC1(C(C)C(CCC(=O)[O-])C(N=1)=C3([C-](C(OC)=O)C(=O)C2(C(C)=C(NC=23)C=C4(C(CC)=C(C)C(=N4)C=C5N6))))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-7061&oldid=20372"