Difference between revisions of "MONO-VINYL-PROTOCHLOROPHYLLIDE-A"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5172 PWY-5172] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-77...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5172 PWY-5172] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MONO-VINYL-PROTOCHLOROPHYLLIDE-A MONO-VINYL-PROTOCHLOROPHYLLIDE-A] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-7742]
+
** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
+
* molecular weight:
 +
** 610.951   
 
* common name:
 
* common name:
** acetyl-CoA biosynthesis III (from citrate)
+
** protochlorophyllide a
 
* Synonym(s):
 
* Synonym(s):
 +
** monovinyl protochlorophyllide a
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''1''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
** [[ATP-CITRATE-PRO-S--LYASE-RXN]]
+
== Reaction(s) of unknown directionality ==
== Reaction(s) not found ==
+
* [[RXN1F-10]]
* '''0''' reaction(s) not found
+
* [[RXN1F-72]]
 
== External links  ==
 
== External links  ==
* ARACYC:
+
* CHEBI:
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5172 PWY-5172]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57855 57855]
{{#set: taxonomic range=TAX-7742}}
+
* CAS : 14751-08-7
{{#set: taxonomic range=TAX-3193}}
+
* PUBCHEM:
{{#set: common name=acetyl-CoA biosynthesis III (from citrate)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54749448 54749448]
{{#set: reaction found=1}}
+
* LIGAND-CPD:
{{#set: reaction not found=0}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02880 C02880]
 +
* HMDB : HMDB31148
 +
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
 +
{{#set: molecular weight=610.951    }}
 +
{{#set: common name=protochlorophyllide a}}
 +
{{#set: common name=monovinyl protochlorophyllide a}}
 +
{{#set: reversible reaction associated=RXN1F-10|RXN1F-72}}

Latest revision as of 15:30, 9 January 2019

Metabolite MONO-VINYL-PROTOCHLOROPHYLLIDE-A

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • molecular weight:
    • 610.951
  • common name:
    • protochlorophyllide a
  • Synonym(s):
    • monovinyl protochlorophyllide a

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.