Difference between revisions of "MONO-VINYL-PROTOCHLOROPHYLLIDE-A"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5107 RXN0-5107] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5107 RXN0-5107] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MONO-VINYL-PROTOCHLOROPHYLLIDE-A MONO-VINYL-PROTOCHLOROPHYLLIDE-A] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.6.1.9 EC-3.6.1.9]
+
** 610.951   
 +
* common name:
 +
** protochlorophyllide a
 
* Synonym(s):
 
* Synonym(s):
 +
** monovinyl protochlorophyllide a
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[WATER]][c] '''+''' 1 [[TTP]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[TMP]][c] '''+''' 1 [[PPI]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN1F-10]]
−
** 1 H2O[c] '''+''' 1 dTTP[c] '''=>''' 1 H+[c] '''+''' 1 dTMP[c] '''+''' 1 diphosphate[c]
+
* [[RXN1F-72]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00009365001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CHEBI:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28534 28534]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57855 57855]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 14751-08-7
−
{{#set: ec number=EC-3.6.1.9}}
+
* PUBCHEM:
−
{{#set: gene associated=CHC_T00009365001_1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54749448 54749448]
−
{{#set: in pathway=}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02880 C02880]
−
{{#set: reconstruction tool=pantograph}}
+
* HMDB : HMDB31148
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
 +
{{#set: molecular weight=610.951    }}
 +
{{#set: common name=protochlorophyllide a}}
 +
{{#set: common name=monovinyl protochlorophyllide a}}
 +
{{#set: reversible reaction associated=RXN1F-10|RXN1F-72}}

Latest revision as of 16:30, 9 January 2019

Metabolite MONO-VINYL-PROTOCHLOROPHYLLIDE-A

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • molecular weight:
    • 610.951
  • common name:
    • protochlorophyllide a
  • Synonym(s):
    • monovinyl protochlorophyllide a

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=MONO-VINYL-PROTOCHLOROPHYLLIDE-A&oldid=20386"