Difference between revisions of "CPD-17858"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE-5-PHOSPHATE XANTHOSINE-5-PHOSPHATE] == * smiles: ** C(OP(=O)([O-])[O-])C1(C(O)C(O)C(...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] == |
* smiles: | * smiles: | ||
− | ** C | + | ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C |
+ | * molecular weight: | ||
+ | ** 849.311 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L |
* common name: | * common name: | ||
− | ** | + | ** ω-saturated C55 dolichol phosphate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ω-saturated dolichol-11 phosphate |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-16602]] |
− | + | ||
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819874 91819874] |
− | + | {{#set: smiles=CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C}} | |
− | + | {{#set: molecular weight=849.311 }} | |
− | + | {{#set: inchi key=InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L}} | |
− | + | {{#set: common name=ω-saturated C55 dolichol phosphate}} | |
− | + | {{#set: common name=ω-saturated dolichol-11 phosphate}} | |
− | + | {{#set: consumed by=RXN-16602}} | |
− | + | ||
− | + | ||
− | {{#set: smiles=C( | + | |
− | + | ||
− | + | ||
− | {{#set: molecular weight= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: consumed | + |
Latest revision as of 15:30, 9 January 2019
Contents
Metabolite CPD-17858
- smiles:
- CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C
- molecular weight:
- 849.311
- inchi key:
- InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L
- common name:
- ω-saturated C55 dolichol phosphate
- Synonym(s):
- ω-saturated dolichol-11 phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C" cannot be used as a page name in this wiki.