Difference between revisions of "RXN-10769"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] == * smiles: ** CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10769 RXN-10769] ==
−
* smiles:
+
* direction:
−
** CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N
+
** [http://enzyme.expasy.org/EC/3.2.1.21 EC-3.2.1.21]
−
* common name:
+
−
** 7-dehydrocholesterol
+
−
* molecular weight:
+
−
** 384.644   
+
 
* Synonym(s):
 
* Synonym(s):
−
** cholesta-5,7-dien-3 β-ol
 
−
** cholesta-5,7-dienol
 
−
** 7-dehydro-cholesterol
 
−
** cholesta-5,7-dien-3β-ol
 
−
** provitamin D3
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[1.14.21.6-RXN]]
+
** 1 [[CPD-11641]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Glucopyranose]][c] '''+''' 1 [[CPD-182]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 4-methylumbelliferyl glucoside[c] '''+''' 1 H2O[c] '''=>''' 1 D-glucopyranose[c] '''+''' 1 4-methylumbelliferone[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009011001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00009266001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 434-16-2
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: ec number=EC-3.2.1.21}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439423 439423]
+
{{#set: gene associated=CHC_T00009011001_1|CHC_T00009266001_1}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17759 17759]
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-ectocarpus_siliculosus}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01164 C01164]
+
{{#set: reconstruction tool=pantograph}}
−
* HMDB : HMDB00032
+
−
{{#set: smiles=CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))}}
+
−
{{#set: inchi key=InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N}}
+
−
{{#set: common name=7-dehydrocholesterol}}
+
−
{{#set: molecular weight=384.644    }}
+
−
{{#set: common name=cholesta-5,7-dien-3 β-ol|cholesta-5,7-dienol|7-dehydro-cholesterol|cholesta-5,7-dien-3β-ol|provitamin D3}}
+
−
{{#set: produced by=1.14.21.6-RXN}}
+

Latest revision as of 15:33, 9 January 2019

Reaction RXN-10769

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 4-methylumbelliferyl glucoside[c] + 1 H2O[c] => 1 D-glucopyranose[c] + 1 4-methylumbelliferone[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-10769&oldid=20468"