Difference between revisions of "PWY-5353"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15717 CPD-15717] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O * inchi key:...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5353 PWY-5353] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** arachidonate biosynthesis I (6-desaturase, lower eukaryotes) |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-3041] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3208 TAX-3208] | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** arachidonic acid biosynthesis I (lower eukaryotes) |
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''2''' reactions found over '''8''' reactions in the full pathway | |
− | * [[ | + | * [[RXN-16043]] |
− | * [[RXN- | + | ** 1 associated gene(s): |
− | == Reaction(s) | + | *** [[CHC_T00007447001_1]] |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RXN-16044]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00007447001_1]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11680 RXN-11680] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12777 RXN-12777] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12968 RXN-12968] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12969 RXN-12969] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12971 RXN-12971] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8346 RXN-8346] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=arachidonate biosynthesis I (6-desaturase, lower eukaryotes)}} | |
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: taxonomic range=TAX-3041}} | |
− | + | {{#set: taxonomic range=TAX-3208}} | |
− | + | {{#set: common name=arachidonic acid biosynthesis I (lower eukaryotes)}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=8}} | |
− | {{#set: | + | {{#set: completion rate=25.0}} |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:34, 9 January 2019
Pathway PWY-5353
- common name:
- arachidonate biosynthesis I (6-desaturase, lower eukaryotes)
- taxonomic range:
- Synonym(s):
- arachidonic acid biosynthesis I (lower eukaryotes)
Reaction(s) found
2 reactions found over 8 reactions in the full pathway
- RXN-16043
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-16044
- 1 associated gene(s):
- 1 reconstruction source(s) associated: