Difference between revisions of "CPD-12935"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1603 RXN-1603] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1603 RXN-1603] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1)
 +
* molecular weight:
 +
** 482.748   
 +
* inchi key:
 +
** InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N
 +
* common name:
 +
** 4'-apo-β-carotenal
 
* Synonym(s):
 
* Synonym(s):
 +
** β-apo-4'-carotenal
 +
** 4'-apo-β,ψ-caroten-4'-al
 +
** 4'-apo-β,ψ-carotenal
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-409]][c] '''=>''' 1 [[CPD-504]][c]
+
* [[RXN-11989]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a 2-acylglycerol[c] '''=>''' 1 a 1-monoglyceride[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[LIPAS-PWY]], triacylglycerol degradation: [http://metacyc.org/META/NEW-IMAGE?object=LIPAS-PWY LIPAS-PWY]
+
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: in pathway=LIPAS-PWY}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=53157 53157]
−
{{#set: reconstruction category=annotation}}
+
* PUBCHEM:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44224033 44224033]
−
{{#set: reconstruction source=original_genome}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C19892 C19892]
 +
{{#set: smiles=CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1)}}
 +
{{#set: molecular weight=482.748    }}
 +
{{#set: inchi key=InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N}}
 +
{{#set: common name=4'-apo-β-carotenal}}
 +
{{#set: common name=β-apo-4'-carotenal|4'-apo-β,ψ-caroten-4'-al|4'-apo-β,ψ-carotenal}}
 +
{{#set: produced by=RXN-11989}}

Latest revision as of 16:34, 9 January 2019

Metabolite CPD-12935

  • smiles:
    • CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1)
  • molecular weight:
    • 482.748
  • inchi key:
    • InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N
  • common name:
    • 4'-apo-β-carotenal
  • Synonym(s):
    • β-apo-4'-carotenal
    • 4'-apo-β,ψ-caroten-4'-al
    • 4'-apo-β,ψ-carotenal

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-12935&oldid=20489"