Difference between revisions of "PWY-5122"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE-5-P L-GLUTAMATE-5-P] == * smiles: ** C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O * in...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE-5-P L-GLUTAMATE-5-P] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5122 PWY-5122] ==
* smiles:
+
** C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O
+
* inchi key:
+
** InChIKey=PJRXVIJAERNUIP-VKHMYHEASA-L
+
 
* common name:
 
* common name:
** γ-L-glutamyl 5-phosphate
+
** geranyl diphosphate biosynthesis
* molecular weight:
+
* taxonomic range:
** 225.094   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 
* Synonym(s):
 
* Synonym(s):
** L-glutamate 5-phosphate
+
** GPP biosynthesis
** γ-L-glutamyl-5-P
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[GLUTSEMIALDEHYDROG-RXN]]
+
'''1''' reactions found over '''1''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[GPPSYN-RXN]]
* [[GLUTKIN-RXN]]
+
** 9 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00005639001_1]]
 +
*** [[CHC_T00003042001_1]]
 +
*** [[CHC_T00004833001_1]]
 +
*** [[CHC_T00002263001_1]]
 +
*** [[CHC_T00002324001_1]]
 +
*** [[CHC_T00006851001_1]]
 +
*** [[CHC_T00008377001_1]]
 +
*** [[CHC_T00000930001_1]]
 +
*** [[CHC_T00008265001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* BIGG : glu5p
+
* ARACYC:
* PUBCHEM:
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5122 PWY-5122]
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44457531 44457531]
+
{{#set: common name=geranyl diphosphate biosynthesis}}
* HMDB : HMDB01228
+
{{#set: taxonomic range=TAX-2157}}
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.genome.jp/dbget-bin/www_bget?C03287 C03287]
+
{{#set: taxonomic range=TAX-2759}}
* CHEBI:
+
{{#set: common name=GPP biosynthesis}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58274 58274]
+
{{#set: reaction found=1}}
* METABOLIGHTS : MTBLC58274
+
{{#set: total reaction=1}}
{{#set: smiles=C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O}}
+
{{#set: completion rate=100.0}}
{{#set: inchi key=InChIKey=PJRXVIJAERNUIP-VKHMYHEASA-L}}
+
{{#set: common name=γ-L-glutamyl 5-phosphate}}
+
{{#set: molecular weight=225.094    }}
+
{{#set: common name=L-glutamate 5-phosphate|γ-L-glutamyl-5-P}}
+
{{#set: consumed by=GLUTSEMIALDEHYDROG-RXN}}
+
{{#set: produced by=GLUTKIN-RXN}}
+

Latest revision as of 15:37, 9 January 2019

Pathway PWY-5122

  • common name:
    • geranyl diphosphate biosynthesis
  • taxonomic range:
  • Synonym(s):
    • GPP biosynthesis

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links