Difference between revisions of "PWY-5122"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE-5-P L-GLUTAMATE-5-P] == * smiles: ** C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O * in...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5122 PWY-5122] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** geranyl diphosphate biosynthesis |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** GPP biosynthesis |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''1''' reactions in the full pathway |
− | + | * [[GPPSYN-RXN]] | |
− | * [[ | + | ** 9 associated gene(s): |
− | == Reaction(s) | + | *** [[CHC_T00005639001_1]] |
+ | *** [[CHC_T00003042001_1]] | ||
+ | *** [[CHC_T00004833001_1]] | ||
+ | *** [[CHC_T00002263001_1]] | ||
+ | *** [[CHC_T00002324001_1]] | ||
+ | *** [[CHC_T00006851001_1]] | ||
+ | *** [[CHC_T00008377001_1]] | ||
+ | *** [[CHC_T00000930001_1]] | ||
+ | *** [[CHC_T00008265001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5122 PWY-5122] | |
− | ** [http:// | + | {{#set: common name=geranyl diphosphate biosynthesis}} |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: common name=GPP biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=1}} | |
− | {{#set: | + | {{#set: completion rate=100.0}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:37, 9 January 2019
Pathway PWY-5122
- common name:
- geranyl diphosphate biosynthesis
- taxonomic range:
- Synonym(s):
- GPP biosynthesis
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- GPPSYN-RXN
- 9 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: