Difference between revisions of "PWY0-862"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-862 PWY0-862] ==
−
* smiles:
+
−
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
+
−
* inchi key:
+
−
** InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K
+
 
* common name:
 
* common name:
−
** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
+
** (5Z)-dodec-5-enoate biosynthesis
−
* molecular weight:
+
* taxonomic range:
−
** 447.424   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
−
** di-trans,poly-cis-geranylgeranyl diphosphate
+
** (5Z)-dodecenoate biosynthesis
−
** ω,E,E,Z-geranylgeranyl diphosphate
+
** cis-dodecenoate biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''6''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-9655]]
−
* [[RXN0-5180]]
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN0-2141]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009465001_1]]
 +
*** [[CHC_T00009465001]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN0-2142]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008496001]]
 +
*** [[CHC_T00008557001]]
 +
*** [[CHC_T00008477001]]
 +
*** [[CHC_T00008517001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN0-2145]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009325001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=5.3.3.14-RXN 5.3.3.14-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2144 RXN0-2144]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245826 25245826]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-862 PWY0-862]
−
* CHEBI:
+
{{#set: common name=(5Z)-dodec-5-enoate biosynthesis}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62639 62639]
+
{{#set: taxonomic range=TAX-2}}
−
* LIGAND-CPD:
+
{{#set: common name=(5Z)-dodecenoate biosynthesis|cis-dodecenoate biosynthesis}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11356 C11356]
+
{{#set: reaction found=4}}
−
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C}}
+
{{#set: total reaction=6}}
−
{{#set: inchi key=InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K}}
+
{{#set: completion rate=67.0}}
−
{{#set: common name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
+
−
{{#set: molecular weight=447.424    }}
+
−
{{#set: common name=di-trans,poly-cis-geranylgeranyl diphosphate|ω,E,E,Z-geranylgeranyl diphosphate}}
+
−
{{#set: consumed or produced by=RXN0-5180}}
+

Latest revision as of 15:38, 9 January 2019

Pathway PWY0-862

  • common name:
    • (5Z)-dodec-5-enoate biosynthesis
  • taxonomic range:
  • Synonym(s):
    • (5Z)-dodecenoate biosynthesis
    • cis-dodecenoate biosynthesis

Reaction(s) found

4 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY0-862&oldid=20584"