Difference between revisions of "3457-TETRAHYDROXY-3-METHOXYFLAVONE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == * smiles: ** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InCh...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3457-TETRAHYDROXY-3-METHOXYFLAVONE 3457-TETRAHYDROXY-3-METHOXYFLAVONE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** COC3(C(=O)C1(C(=CC([O-])=CC(O)=1)OC(C2(C=C(O)C(O)=CC=2))=3)) |
| + | * molecular weight: | ||
| + | ** 315.259 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=WEPBGSIAWZTEJR-UHFFFAOYSA-M |
* common name: | * common name: | ||
| − | ** | + | ** 3-O-methylquercetin |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-methoxy-5,7,3',4'-tetrahydroxyflavone | ||
| + | ** 3-methoxyluteolin | ||
| + | ** 3',4',5,7-tetrahydroxy-3-methoxyflavone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[QUERCETIN-3-O-METHYLTRANSFERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57928 57928] | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202270 25202270] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04443 C04443] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=COC3(C(=O)C1(C(=CC([O-])=CC(O)=1)OC(C2(C=C(O)C(O)=CC=2))=3))}} |
| − | {{#set: common name= | + | {{#set: molecular weight=315.259 }} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=WEPBGSIAWZTEJR-UHFFFAOYSA-M}} |
| − | {{#set: produced by= | + | {{#set: common name=3-O-methylquercetin}} |
| + | {{#set: common name=3-methoxy-5,7,3',4'-tetrahydroxyflavone|3-methoxyluteolin|3',4',5,7-tetrahydroxy-3-methoxyflavone}} | ||
| + | {{#set: produced by=QUERCETIN-3-O-METHYLTRANSFERASE-RXN}} | ||
Latest revision as of 15:40, 9 January 2019
Contents
Metabolite 3457-TETRAHYDROXY-3-METHOXYFLAVONE
- smiles:
- COC3(C(=O)C1(C(=CC([O-])=CC(O)=1)OC(C2(C=C(O)C(O)=CC=2))=3))
- molecular weight:
- 315.259
- inchi key:
- InChIKey=WEPBGSIAWZTEJR-UHFFFAOYSA-M
- common name:
- 3-O-methylquercetin
- Synonym(s):
- 3-methoxy-5,7,3',4'-tetrahydroxyflavone
- 3-methoxyluteolin
- 3',4',5,7-tetrahydroxy-3-methoxyflavone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"COC3(C(=O)C1(C(=CC([O-])=CC(O)=1)OC(C2(C=C(O)C(O)=CC=2))=3))" cannot be used as a page name in this wiki.
