Difference between revisions of "RXN-13883"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GMP GMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inch...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13883 RXN-13883] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.14.19.20 EC-1.14.19.20] |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 2 [[PROTON]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-14893]][c] '''=>''' 1 [[CPD-14894]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c] | |
− | = | + | * With common name(s): |
− | * [[ | + | ** 2 H+[c] '''+''' 2 a ferrocytochrome b5[c] '''+''' 1 oxygen[c] '''+''' 1 ergost-7-enol[c] '''=>''' 1 ergosta-5,7-dienol[c] '''+''' 2 a ferricytochrome b5[c] '''+''' 2 H2O[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[CHC_T00006481001_1]] |
− | == | + | ** Source: [[orthology-galdieria.sulphuraria]] |
− | * [[ | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
+ | == Pathways == | ||
+ | * [[PWY-7154]], ergosterol biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7154 PWY-7154] | ||
+ | ** '''2''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-1.14.19.20}} | |
− | + | {{#set: gene associated=CHC_T00006481001_1}} | |
− | + | {{#set: in pathway=PWY-7154}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-ectocarpus_siliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:40, 9 January 2019
Contents
Reaction RXN-13883
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 2 PROTON[c] + 2 FERROCYTOCHROME-B5[c] + 1 OXYGEN-MOLECULE[c] + 1 CPD-14893[c] => 1 CPD-14894[c] + 2 FERRICYTOCHROME-B5[c] + 2 WATER[c]
- With common name(s):
- 2 H+[c] + 2 a ferrocytochrome b5[c] + 1 oxygen[c] + 1 ergost-7-enol[c] => 1 ergosta-5,7-dienol[c] + 2 a ferricytochrome b5[c] + 2 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00006481001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
Pathways
- PWY-7154, ergosterol biosynthesis II: PWY-7154
- 2 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria