Difference between revisions of "PWY-699"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7229 CPD-7229] == * smiles: ** C(C2(OC(N1(C=C(CC=C1)C(=O)N))C(C(O)2)O))O * common name: **...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-699 PWY-699] == |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** brassinosteroid biosynthesis I |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | == Reaction(s) | + | '''2''' reactions found over '''25''' reactions in the full pathway |
− | == | + | * [[RXN-715]] |
− | * [[ | + | ** 1 associated gene(s): |
+ | *** [[CHC_T00009303001_1]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RXN-773]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00009303001_1]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11535 RXN-11535] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11536 RXN-11536] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16171 RXN-16171] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16172 RXN-16172] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16173 RXN-16173] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-4241 RXN-4241] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-709 RXN-709] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-710 RXN-710] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-711 RXN-711] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-712 RXN-712] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-713 RXN-713] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-714 RXN-714] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-716 RXN-716] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-717 RXN-717] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-718 RXN-718] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-719 RXN-719] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-720 RXN-720] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-774 RXN-774] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-775 RXN-775] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-776 RXN-776] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-777 RXN-777] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-778 RXN-778] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-779 RXN-779] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-699 PWY-699] |
− | + | {{#set: common name=brassinosteroid biosynthesis I}} | |
− | + | {{#set: taxonomic range=TAX-3193}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=25}} | |
− | + | {{#set: completion rate=8.0}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 15:42, 9 January 2019
Pathway PWY-699
- common name:
- brassinosteroid biosynthesis I
- taxonomic range:
- Synonym(s):
Reaction(s) found
2 reactions found over 25 reactions in the full pathway
- RXN-715
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-773
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
- RXN-11535
- RXN-11536
- RXN-16171
- RXN-16172
- RXN-16173
- RXN-4241
- RXN-709
- RXN-710
- RXN-711
- RXN-712
- RXN-713
- RXN-714
- RXN-716
- RXN-717
- RXN-718
- RXN-719
- RXN-720
- RXN-774
- RXN-775
- RXN-776
- RXN-777
- RXN-778
- RXN-779
External links
- ARACYC: