Difference between revisions of "ASPASN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C * inchi key: ** InCh...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ASPASN-PWY ASPASN-PWY] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** superpathway of L-aspartate and L-asparagine biosynthesis |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** Interconversion of L-aspartate and L-asparagine |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''4''' reactions found over '''7''' reactions in the full pathway |
| − | + | * [[ASPARAGHYD-RXN]] | |
| − | == Reaction(s) | + | ** 4 associated gene(s): |
| + | *** [[CHC_T00002545001_1]] | ||
| + | *** [[CHC_T00000306001_1]] | ||
| + | *** [[CHC_T00001474001_1]] | ||
| + | *** [[CHC_T00002449001_1]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[ASPARAGINESYN-PWY]] | ||
| + | ** 0 associated gene: | ||
| + | * [[ASPARTATESYN-PWY]] | ||
| + | ** 0 associated gene: | ||
| + | * [[GLUTDEG-PWY]] | ||
| + | ** 0 associated gene: | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=ASPASN-PWY ASPASN-PWY] |
| − | + | {{#set: common name=superpathway of L-aspartate and L-asparagine biosynthesis}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=Interconversion of L-aspartate and L-asparagine}} | |
| − | + | {{#set: reaction found=4}} | |
| − | {{#set: | + | {{#set: total reaction=7}} |
| − | {{#set: | + | {{#set: completion rate=56.99999999999999}} |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 16:43, 9 January 2019
Pathway ASPASN-PWY
- common name:
- superpathway of L-aspartate and L-asparagine biosynthesis
- taxonomic range:
- Synonym(s):
- Interconversion of L-aspartate and L-asparagine
Reaction(s) found
4 reactions found over 7 reactions in the full pathway
- ASPARAGHYD-RXN
- 4 associated gene(s):
- 2 reconstruction source(s) associated:
- ASPARAGINESYN-PWY
- 0 associated gene:
- ASPARTATESYN-PWY
- 0 associated gene:
- GLUTDEG-PWY
- 0 associated gene:
Reaction(s) not found
External links
- ECOCYC:
