Difference between revisions of "L-HISTIDINOL-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] == * smiles: ** C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+]) * inchi key...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+]) | ** C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+]) | ||
| + | * molecular weight: | ||
| + | ** 220.144 | ||
* inchi key: | * inchi key: | ||
** InChIKey=CWNDERHTHMWBSI-YFKPBYRVSA-M | ** InChIKey=CWNDERHTHMWBSI-YFKPBYRVSA-M | ||
* common name: | * common name: | ||
** L-histidinol-phosphate | ** L-histidinol-phosphate | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** histidinol-P | ** histidinol-P | ||
| Line 15: | Line 15: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]] | * [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]] | ||
| + | * [[HISTIDPHOS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[HISTAMINOTRANS-RXN]] | * [[HISTAMINOTRANS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* KNAPSACK : C00007480 | * KNAPSACK : C00007480 | ||
| − | * | + | * BIGG : hisp |
| − | * | + | * CAS : 25679-93-0 |
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57980 57980] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57980 57980] | ||
| − | * | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01100 C01100] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791964 49791964] | ||
{{#set: smiles=C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+])}} | {{#set: smiles=C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+])}} | ||
| + | {{#set: molecular weight=220.144 }} | ||
{{#set: inchi key=InChIKey=CWNDERHTHMWBSI-YFKPBYRVSA-M}} | {{#set: inchi key=InChIKey=CWNDERHTHMWBSI-YFKPBYRVSA-M}} | ||
{{#set: common name=L-histidinol-phosphate}} | {{#set: common name=L-histidinol-phosphate}} | ||
| − | |||
{{#set: common name=histidinol-P|L-histidinol-p|histidinol-phosphate}} | {{#set: common name=histidinol-P|L-histidinol-p|histidinol-phosphate}} | ||
| − | {{#set: consumed by= | + | {{#set: consumed by=HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.|HISTIDPHOS-RXN}} |
{{#set: produced by=HISTAMINOTRANS-RXN}} | {{#set: produced by=HISTAMINOTRANS-RXN}} | ||
Latest revision as of 15:43, 9 January 2019
Contents
Metabolite L-HISTIDINOL-P
- smiles:
- C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+])
- molecular weight:
- 220.144
- inchi key:
- InChIKey=CWNDERHTHMWBSI-YFKPBYRVSA-M
- common name:
- L-histidinol-phosphate
- Synonym(s):
- histidinol-P
- L-histidinol-p
- histidinol-phosphate
Reaction(s) known to consume the compound
- [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]]
- HISTIDPHOS-RXN
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+])" cannot be used as a page name in this wiki.
"HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49." cannot be used as a page name in this wiki.
