Difference between revisions of "HISTIDINAL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16389 RXN-16389] == * direction: ** LEFT-TO-RIGHT * common name: ** long-chain-fatty-acid-CoA l...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16389 RXN-16389] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C1(NC=NC=1CC([CH]=O)[N+])
 +
* molecular weight:
 +
** 140.164   
 +
* inchi key:
 +
** InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O
 
* common name:
 
* common name:
** long-chain-fatty-acid-CoA ligase
+
** histidinal
* ec number:
+
** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** L-histidinal
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[HISTALDEHYD-RXN]]
** 1 [[16-HYDROXYPALMITATE]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[CPD-17621]][c] '''+''' 1 [[PPI]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 16-hydroxypalmitate[c] '''+''' 1 coenzyme A[c] '''+''' 1 ATP[c] '''=>''' 1 AMP[c] '''+''' 1 16-hydroxypalmitoyl-CoA[c] '''+''' 1 diphosphate[c]
+
* [[HISTOLDEHYD-RXN]]
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00009428001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00008160001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00008811001]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
* [[CHC_T00008811001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00009428001]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
* [[CHC_T00008500001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways  ==
+
* [[PWY-321]], cutin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-321 PWY-321]
+
** '''1''' reactions found over '''16''' reactions in the full pathway
+
* [[PWY-6733]], sporopollenin precursors biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6733 PWY-6733]
+
** '''4''' reactions found over '''18''' reactions in the full pathway
+
* [[PWY-1121]], suberin monomers biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-1121 PWY-1121]
+
** '''7''' reactions found over '''19''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
{{#set: common name=long-chain-fatty-acid-CoA ligase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64802 64802]
{{#set: ec number=EC-6.2.1.3}}
+
* PUBCHEM:
{{#set: gene associated=CHC_T00009428001_1|CHC_T00008160001_1|CHC_T00008811001|CHC_T00008811001_1|CHC_T00009428001|CHC_T00008500001_1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339283 57339283]
{{#set: in pathway=PWY-321|PWY-6733|PWY-1121}}
+
* LIGAND-CPD:
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01929 C01929]
{{#set: reconstruction tool=pantograph}}
+
* HMDB : HMDB12234
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: smiles=C1(NC=NC=1CC([CH]=O)[N+])}}
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=140.164    }}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O}}
{{#set: reconstruction source=original_genome}}
+
{{#set: common name=histidinal}}
 +
{{#set: common name=L-histidinal}}
 +
{{#set: consumed by=HISTALDEHYD-RXN}}
 +
{{#set: reversible reaction associated=HISTOLDEHYD-RXN}}

Latest revision as of 15:43, 9 January 2019

Metabolite HISTIDINAL

  • smiles:
    • C1(NC=NC=1CC([CH]=O)[N+])
  • molecular weight:
    • 140.164
  • inchi key:
    • InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O
  • common name:
    • histidinal
  • Synonym(s):
    • L-histidinal

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(NC=NC=1CC([CH]=O)[N+])" cannot be used as a page name in this wiki.