Difference between revisions of "CPD-15153"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5047 PWY-5047] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15153 CPD-15153] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C(C)=1) |
+ | * molecular weight: | ||
+ | ** 697.095 | ||
+ | * inchi key: | ||
+ | ** InChIKey=FLYBTLROCQBHMR-KFSSTAEESA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-14177]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28636 28636] |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280836 5280836] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05814 C05814] | ||
+ | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C(C)=1)}} | ||
+ | {{#set: molecular weight=697.095 }} | ||
+ | {{#set: inchi key=InChIKey=FLYBTLROCQBHMR-KFSSTAEESA-N}} | ||
+ | {{#set: common name=3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone}} | ||
+ | {{#set: produced by=RXN-14177}} |
Latest revision as of 15:44, 9 January 2019
Contents
Metabolite CPD-15153
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C(C)=1)
- molecular weight:
- 697.095
- inchi key:
- InChIKey=FLYBTLROCQBHMR-KFSSTAEESA-N
- common name:
- 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links