Difference between revisions of "CHC T00008765001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) * inchi key: **...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene CHC_T00008765001_1 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * Reaction: [[MALONYL-COA-ACP-TRANSACYL-RXN]] |
| − | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
| − | == | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
| + | * Reaction: [[RXN-9728]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | == Pathways associated == | ||
| + | * [[PWY-5794]] | ||
| + | * [[PWY-4381]] | ||
| + | * [[PWY-6799]] | ||
| + | * [[PWY-7388]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=MALONYL-COA-ACP-TRANSACYL-RXN|RXN-9728}} | |
| − | + | {{#set: pathway associated=PWY-5794|PWY-4381|PWY-6799|PWY-7388}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 15:44, 9 January 2019
Gene CHC_T00008765001_1
- Synonym(s):
Reactions associated
- Reaction: MALONYL-COA-ACP-TRANSACYL-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN-9728
- Source: orthology-galdieria.sulphuraria
