Difference between revisions of "CPD-12129"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NARINGENIN-CMPD NARINGENIN-CMPD] == * smiles: ** C3(=C(C2(OC1(C(=C(C=C(C=1)O)O)C(C2)=O)))C=CC(=...") |
|||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12129 CPD-12129] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C |
+ | * molecular weight: | ||
+ | ** 991.617 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=FWFJGQGPMZXTLM-WPPIEQSHSA-N |
* common name: | * common name: | ||
− | ** | + | ** menaquinol-12 |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** MKH2-12 |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-9363]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84550 84550] |
− | * | + | * PUBCHEM: |
− | {{#set: smiles= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479280 45479280] |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C}} |
− | {{#set: common name= | + | {{#set: molecular weight=991.617 }} |
− | + | {{#set: inchi key=InChIKey=FWFJGQGPMZXTLM-WPPIEQSHSA-N}} | |
− | {{#set: common name= | + | {{#set: common name=menaquinol-12}} |
− | {{#set: produced by= | + | {{#set: common name=MKH2-12}} |
+ | {{#set: produced by=RXN-9363}} |
Latest revision as of 16:44, 9 January 2019
Contents
Metabolite CPD-12129
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C
- molecular weight:
- 991.617
- inchi key:
- InChIKey=FWFJGQGPMZXTLM-WPPIEQSHSA-N
- common name:
- menaquinol-12
- Synonym(s):
- MKH2-12
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links