Difference between revisions of "CPD-11879"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13883 RXN-13883] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13883 RXN-13883] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11879 CPD-11879] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(=O)([O-])C(C1(=CC=C(O)C(O)=C1))O
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/1.14.19.20 EC-1.14.19.20]
+
** 183.14  
 +
* inchi key:
 +
** InChIKey=RGHMISIYKIHAJW-SSDOTTSWSA-M
 +
* common name:
 +
** 3,4-dihydroxymandelate
 
* Synonym(s):
 
* Synonym(s):
 +
** 3,4-dihydroxymandelic acid
 +
** dihydroxymandelic acid
 +
** mandelic acid, 3,4-dihydroxy-
 +
** DHMA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-14893]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[CPD-14894]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c]
+
* [[RXN-10912]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 oxygen[c] '''+''' 1 ergost-7-enol[c] '''+''' 2 a ferrocytochrome b5[c] '''+''' 2 H+[c] '''=>''' 1 ergosta-5,7-dienol[c] '''+''' 2 a ferricytochrome b5[c] '''+''' 2 H2O[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00006481001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways  ==
+
* [[PWY-7154]], ergosterol biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7154 PWY-7154]
+
** '''2''' reactions found over '''8''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* METABOLIGHTS : MTBLC27637
{{#set: ec number=EC-1.14.19.20}}
+
* LIGAND-CPD:
{{#set: gene associated=CHC_T00006481001_1}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05580 C05580]
{{#set: in pathway=PWY-7154}}
+
* HMDB : HMDB01866
{{#set: reconstruction category=orthology}}
+
* CHEMSPIDER:
{{#set: reconstruction tool=pantograph}}
+
** [http://www.chemspider.com/Chemical-Structure.77371.html 77371]
{{#set: reconstruction source=galdieria.sulphuraria}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27637 27637]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6950180 6950180]
 +
{{#set: smiles=C(=O)([O-])C(C1(=CC=C(O)C(O)=C1))O}}
 +
{{#set: molecular weight=183.14    }}
 +
{{#set: inchi key=InChIKey=RGHMISIYKIHAJW-SSDOTTSWSA-M}}
 +
{{#set: common name=3,4-dihydroxymandelate}}
 +
{{#set: common name=3,4-dihydroxymandelic acid|dihydroxymandelic acid|mandelic acid, 3,4-dihydroxy-|DHMA}}
 +
{{#set: produced by=RXN-10912}}

Latest revision as of 15:45, 9 January 2019

Metabolite CPD-11879

  • smiles:
    • C(=O)([O-])C(C1(=CC=C(O)C(O)=C1))O
  • molecular weight:
    • 183.14
  • inchi key:
    • InChIKey=RGHMISIYKIHAJW-SSDOTTSWSA-M
  • common name:
    • 3,4-dihydroxymandelate
  • Synonym(s):
    • 3,4-dihydroxymandelic acid
    • dihydroxymandelic acid
    • mandelic acid, 3,4-dihydroxy-
    • DHMA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])C(C1(=CC=C(O)C(O)=C1))O" cannot be used as a page name in this wiki.