Difference between revisions of "1CMET2-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9610 CPD-9610] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9610 CPD-9610] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=1CMET2-PWY 1CMET2-PWY] ==
−
* smiles:
+
−
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
+
−
* inchi key:
+
−
** InChIKey=FSCYHDCTHRVSKN-CMVHWAPMSA-K
+
 
* common name:
 
* common name:
−
** all-trans-decaprenyl diphosphate
+
** N10-formyl-tetrahydrofolate biosynthesis
−
* molecular weight:
+
* taxonomic range:
−
** 856.133   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
 +
** N10-formyl-THF biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-9230]]
+
'''7''' reactions found over '''9''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[1.5.1.20-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[CHC_T00008486001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[DIHYDROFOLATEREDUCT-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00010030001_1]]
 +
*** [[CHC_T00008680001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[GLYOHMETRANS-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009460001_1]]
 +
*** [[CHC_T00008323001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[HOMOCYSMETB12-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00005524001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[METHENYLTHFCYCLOHYDRO-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00008680001_1]]
 +
*** [[CHC_T00008670001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
 +
** 3 associated gene(s):
 +
*** [[CHC_T00008670001_1]]
 +
*** [[CHC_T00008680001_1]]
 +
*** [[CHC_T00008680001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[THYMIDYLATESYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00010030001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=5-FORMYL-THF-CYCLO-LIGASE-RXN 5-FORMYL-THF-CYCLO-LIGASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GCVMULTI-RXN GCVMULTI-RXN]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* ECOCYC:
−
** [http://www.genome.jp/dbget-bin/www_bget?C17432 C17432]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=1CMET2-PWY 1CMET2-PWY]
−
* CHEBI:
+
{{#set: common name=N10-formyl-tetrahydrofolate biosynthesis}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60721 60721]
+
{{#set: taxonomic range=TAX-4751}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33208}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245574 25245574]
+
{{#set: taxonomic range=TAX-2}}
−
* HMDB : HMDB59616
+
{{#set: common name=N10-formyl-THF biosynthesis}}
−
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C}}
+
{{#set: reaction found=7}}
−
{{#set: inchi key=InChIKey=FSCYHDCTHRVSKN-CMVHWAPMSA-K}}
+
{{#set: total reaction=9}}
−
{{#set: common name=all-trans-decaprenyl diphosphate}}
+
{{#set: completion rate=78.0}}
−
{{#set: molecular weight=856.133    }}
+
−
{{#set: consumed by=RXN-9230}}
+

Latest revision as of 16:45, 9 January 2019

Pathway 1CMET2-PWY

  • common name:
    • N10-formyl-tetrahydrofolate biosynthesis
  • taxonomic range:
  • Synonym(s):
    • N10-formyl-THF biosynthesis

Reaction(s) found

7 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links





Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=1CMET2-PWY&oldid=20766"