Difference between revisions of "RIBITOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-PYROPHOSPHATE THIAMINE-PYROPHOSPHATE] == * smiles: ** CC1([N+](=CSC(CCOP([O-])(=O)OP([...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL RIBITOL] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(O)C(O)C(O)C(O)CO |
| + | * molecular weight: | ||
| + | ** 152.147 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N |
* common name: | * common name: | ||
| − | ** | + | ** ribitol |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** meso-ribitol |
| − | ** | + | ** adonitol |
| − | ** | + | ** (2R,3s,4S)-pentane-1,2,3,4,5-pentol |
| − | + | ** D-ribitol | |
| − | + | ||
| − | ** | + | |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RIBITOL-2-DEHYDROGENASE-RXN]] |
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15963 15963] |
| − | * | + | * CAS : 488-81-3 |
| − | {{#set: smiles= | + | * LIGAND-CPD: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00474 C00474] |
| − | {{#set: common name= | + | * METABOLIGHTS : MTBLC15963 |
| − | + | * HMDB : HMDB00508 | |
| − | {{#set: common name= | + | {{#set: smiles=C(O)C(O)C(O)C(O)CO}} |
| − | + | {{#set: molecular weight=152.147 }} | |
| − | {{#set: | + | {{#set: inchi key=InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N}} |
| − | + | {{#set: common name=ribitol}} | |
| + | {{#set: common name=meso-ribitol|adonitol|(2R,3s,4S)-pentane-1,2,3,4,5-pentol|D-ribitol}} | ||
| + | {{#set: reversible reaction associated=RIBITOL-2-DEHYDROGENASE-RXN}} | ||
Latest revision as of 15:45, 9 January 2019
Contents
Metabolite RIBITOL
- smiles:
- C(O)C(O)C(O)C(O)CO
- molecular weight:
- 152.147
- inchi key:
- InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N
- common name:
- ribitol
- Synonym(s):
- meso-ribitol
- adonitol
- (2R,3s,4S)-pentane-1,2,3,4,5-pentol
- D-ribitol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
