Difference between revisions of "CHC T00003262001 1"

Latest revision as of 16:46, 9 January 2019

@@ Line 1: / Line 1: @@
-[[Category:Metabolite]]
+[[Category:Gene]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCYL-PEPTIDE GLYCYL-PEPTIDE] ==
+== Gene CHC_T00003262001_1 ==
-* smiles:
-** C(C(NC(C(O)=O)[R])=O)N
-* common name:
-** glycyl-peptide
 * Synonym(s):
-== Reaction(s) known to consume the compound ==
+== Reactions associated ==
-== Reaction(s) known to produce the compound ==
+* Reaction: [[KDOTRANS-RXN]]
-== Reaction(s) of unknown directionality ==
+** Source: [[orthology-galdieria.sulphuraria]]
-* [[2.3.1.97-RXN]]
+** Source: [[orthology-arabidopsis_thaliana]]
+* Reaction: [[KDOTRANS2-RXN]]
+** Source: [[orthology-arabidopsis_thaliana]]
+== Pathways associated ==
+* [[PWY-7675]]
+* [[KDOSYN-PWY]]
 == External links  ==
-* LIGAND-CPD:
+{{#set: reaction associated=KDOTRANS-RXN|KDOTRANS2-RXN}}
-** [http://www.genome.jp/dbget-bin/www_bget?C02038 C02038]
+{{#set: pathway associated=PWY-7675|KDOSYN-PWY}}
-* CHEBI:
-** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16462 16462]
-{{#set: smiles=C(C(NC(C(O)=O)[R])=O)N}}
-{{#set: common name=glycyl-peptide}}
-{{#set: consumed or produced by=2.3.1.97-RXN}}