Difference between revisions of "PWY-4621"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == * smiles: ** C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1) * inchi key: *...") |
|||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4621 PWY-4621] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** arsenate detoxification II (glutaredoxin) |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''2''' reactions found over '''2''' reactions in the full pathway | |
− | * [[ | + | * [[3.6.3.16-RXN]] |
− | * [[ | + | ** 4 associated gene(s): |
− | == Reaction(s) | + | *** [[CHC_T00006022001_1]] |
+ | *** [[CHC_T00006037001_1]] | ||
+ | *** [[CHC_T00009174001]] | ||
+ | *** [[CHC_T00009174001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | * [[RXN-982]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00008414001_1]] | ||
+ | *** [[CHC_T00010347001_1]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-4621 PWY-4621] |
− | + | {{#set: common name=arsenate detoxification II (glutaredoxin)}} | |
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=2}} | |
− | {{#set: | + | {{#set: completion rate=100.0}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:46, 9 January 2019
Pathway PWY-4621
- common name:
- arsenate detoxification II (glutaredoxin)
- taxonomic range:
- Synonym(s):
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- 3.6.3.16-RXN
- 4 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-982
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: