Difference between revisions of "CHC T00010087001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] == * smiles: ** CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] ==
+
== Gene CHC_T00010087001_1 ==
* smiles:
+
** CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J
+
* common name:
+
** 3-oxo-(9Z)-octadecenoyl-CoA
+
* molecular weight:
+
** 1041.936   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-18:1-Δ9-CoA
 
** 3-oxo-9-cis-octadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17778]]
+
* Reaction: [[NADH-DEHYDROG-A-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-galdieria.sulphuraria]]
* [[RXN-17777]]
+
** Source: [[orthology-ectocarpus_siliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY0-1335]]
 +
* [[PWY0-1334]]
 +
* [[PWY-6692]]
 +
* [[PWY-5083]]
 +
* [[PWY-3781]]
 +
* [[PWY-4302]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=NADH-DEHYDROG-A-RXN}}
{{#set: inchi key=InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J}}
+
{{#set: pathway associated=PWY0-1335|PWY0-1334|PWY-6692|PWY-5083|PWY-3781|PWY-4302}}
{{#set: common name=3-oxo-(9Z)-octadecenoyl-CoA}}
+
{{#set: molecular weight=1041.936    }}
+
{{#set: common name=3-oxo-18:1-Δ9-CoA|3-oxo-9-cis-octadecenoyl-CoA}}
+
{{#set: consumed by=RXN-17778}}
+
{{#set: produced by=RXN-17777}}
+

Latest revision as of 16:47, 9 January 2019

Gene CHC_T00010087001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links