Difference between revisions of "BUTANAL-DEHYDROGENASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=BUTANAL-DEHYDROGENASE-RXN BUTANAL-DEHYDROGENASE-RXN] ==
−
* smiles:
+
* direction:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** REVERSIBLE
−
* common name:
+
* ec number:
−
** chlorophyllide a
+
** [http://enzyme.expasy.org/EC/1.2.1.57 EC-1.2.1.57]
−
* molecular weight:
+
−
** 612.967   
+
 
* Synonym(s):
 
* Synonym(s):
−
** chlorophyllide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-7663]]
+
* With identifiers:
−
* [[RXN-17429]]
+
** 1 [[BUTANAL]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''<=>''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[BUTYRYL-COA]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN-5286]]
+
** 1 butan-1-al[c] '''+''' 1 coenzyme A[c] '''+''' 1 NAD(P)+[c] '''<=>''' 1 NAD(P)H[c] '''+''' 1 H+[c] '''+''' 1 butanoyl-CoA[c]
−
== Reaction(s) of unknown directionality ==
+
 
−
* [[RXN1F-10]]
+
== Genes associated with this reaction  ==
−
* [[RXN1F-66]]
+
== Pathways  ==
 +
* [[PWY-6883]], pyruvate fermentation to butanol II (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6883 PWY-6883]
 +
** '''6''' reactions found over '''6''' reactions in the full pathway
 +
* [[PWY-6583]], pyruvate fermentation to butanol I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6583 PWY-6583]
 +
** '''7''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[gap-filling]]
 +
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
*** Tool: [[meneco]]
 +
**** Comment: [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
−
* CAS : 14897-06-4
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22975 22975]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54729368 54729368]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22971 22971]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83348 83348]
+
** [http://www.genome.jp/dbget-bin/www_bget?R01173 R01173]
−
* LIGAND-CPD:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02139 C02139]
+
{{#set: ec number=EC-1.2.1.57}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: in pathway=PWY-6883|PWY-6583}}
−
{{#set: common name=chlorophyllide a}}
+
{{#set: reconstruction category=gap-filling}}
−
{{#set: molecular weight=612.967    }}
+
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
−
{{#set: common name=chlorophyllide}}
+
{{#set: reconstruction tool=meneco}}
−
{{#set: consumed by=RXN-7663|RXN-17429}}
+
{{#set: reconstruction comment=added for gapfilling}}
−
{{#set: produced by=RXN-5286}}
+
−
{{#set: consumed or produced by=RXN1F-10|RXN1F-66}}
+

Latest revision as of 16:49, 9 January 2019

Reaction BUTANAL-DEHYDROGENASE-RXN

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-6883, pyruvate fermentation to butanol II (engineered): PWY-6883
    • 6 reactions found over 6 reactions in the full pathway
  • PWY-6583, pyruvate fermentation to butanol I: PWY-6583
    • 7 reactions found over 8 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=BUTANAL-DEHYDROGENASE-RXN&oldid=20862"