Difference between revisions of "P221-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11937 CPD-11937] == * smiles: ** C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-]...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11937 CPD-11937] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=P221-PWY P221-PWY] ==
* smiles:
+
** C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1)
+
* inchi key:
+
** InChIKey=UPHPWXPNZIOZJL-PTQMNWPWSA-B
+
 
* common name:
 
* common name:
** 1D-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
+
** octane oxidation
* molecular weight:
+
* taxonomic range:
** 727.921   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
** 3-PP-InsP5
 
** 3-diphospho-1D-myo-inositol pentakisphosphate
 
** 3-diphospho-1D-myo-inositol 1,2,4,5,6-pentakisphosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-10973]]
+
'''3''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ALKANE-1-MONOOXYGENASE-RXN]]
* [[RXN-10971]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00010276001_1]]
 +
*** [[CHC_T00010276001]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
* [[R222-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00008341001_1]]
 +
*** [[CHC_T00008341001]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
* [[R223-RXN]]
 +
** 6 associated gene(s):
 +
*** [[CHC_T00008160001_1]]
 +
*** [[CHC_T00008811001]]
 +
*** [[CHC_T00009428001_1]]
 +
*** [[CHC_T00009428001]]
 +
*** [[CHC_T00008500001_1]]
 +
*** [[CHC_T00008811001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R221-RXN R221-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RUBREDOXIN--NAD+-REDUCTASE-RXN RUBREDOXIN--NAD+-REDUCTASE-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* UM-BBD-PWY : oct
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173206 46173206]
+
{{#set: common name=octane oxidation}}
{{#set: smiles=C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1)}}
+
{{#set: taxonomic range=TAX-4751}}
{{#set: inchi key=InChIKey=UPHPWXPNZIOZJL-PTQMNWPWSA-B}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: common name=1D-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate}}
+
{{#set: reaction found=3}}
{{#set: molecular weight=727.921    }}
+
{{#set: total reaction=5}}
{{#set: common name=3-PP-InsP5|3-diphospho-1D-myo-inositol pentakisphosphate|3-diphospho-1D-myo-inositol 1,2,4,5,6-pentakisphosphate}}
+
{{#set: completion rate=60.0}}
{{#set: consumed by=RXN-10973}}
+
{{#set: produced by=RXN-10971}}
+

Latest revision as of 16:49, 9 January 2019

Pathway P221-PWY

  • common name:
    • octane oxidation
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

3 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links

  • UM-BBD-PWY : oct