Difference between revisions of "CPD0-1028"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8844 CPD-8844] == * smiles: ** C=CC=C(CCC=C(C)C)C * common name: ** (3E)-4,8-dimethylnona-1...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 447.424 |
| + | * inchi key: | ||
| + | ** InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K | ||
| + | * common name: | ||
| + | ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** di-trans,poly-cis-geranylgeranyl diphosphate |
| − | ** | + | ** ω,E,E,Z-geranylgeranyl diphosphate |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN0-5180]] | ||
| + | * [[RXN-13323]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62639 62639] |
| − | * | + | * PUBCHEM: |
| − | {{#set: smiles | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245826 25245826] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11356 C11356] |
| − | {{#set: | + | {{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C}} |
| − | {{#set: common name= | + | {{#set: molecular weight=447.424 }} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K}} |
| + | {{#set: common name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}} | ||
| + | {{#set: common name=di-trans,poly-cis-geranylgeranyl diphosphate|ω,E,E,Z-geranylgeranyl diphosphate}} | ||
| + | {{#set: reversible reaction associated=RXN0-5180|RXN-13323}} | ||
Latest revision as of 15:50, 9 January 2019
Contents
Metabolite CPD0-1028
- smiles:
- CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
- molecular weight:
- 447.424
- inchi key:
- InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K
- common name:
- 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
- Synonym(s):
- di-trans,poly-cis-geranylgeranyl diphosphate
- ω,E,E,Z-geranylgeranyl diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C" cannot be used as a page name in this wiki.
