Difference between revisions of "PWY-6105"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTETRAOSE MALTOTETRAOSE] == * smiles: ** C(C4(OC(OC3(C(OC(OC2(C(OC(OC1(C(OC(O)C(C1O)O)CO))C...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTETRAOSE MALTOTETRAOSE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6105 PWY-6105] ==
* smiles:
+
** C(C4(OC(OC3(C(OC(OC2(C(OC(OC1(C(OC(O)C(C1O)O)CO))C(C2O)O)CO))C(C3O)O)CO))C(C(O)C4O)O))O
+
* inchi key:
+
** InChIKey=LUEWUZLMQUOBSB-AYQJAVFRSA-N
+
 
* common name:
 
* common name:
** maltotetraose
+
** botryococcenes and methylated squalene biosynthesis
* molecular weight:
+
* taxonomic range:
** 666.583   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-38879 TAX-38879]
 
* Synonym(s):
 
* Synonym(s):
 +
** botryococcene hydrocarbon biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN0-5182]]
+
'''2''' reactions found over '''9''' reactions in the full pathway
* [[RXN-14260]]
+
* [[RXN-12263]]
== Reaction(s) known to produce the compound ==
+
** 1 associated gene(s):
* [[RXN-14281]]
+
*** [[CHC_T00001581001_1]]
* [[AMYLOMALT-RXN]]
+
** 3 reconstruction source(s) associated:
* [[RXN-14284]]
+
*** [[orthology-galdieria.sulphuraria]]
== Reaction(s) of unknown directionality ==
+
*** [[orthology-arabidopsis_thaliana]]
* [[GLYMALTOPHOSPHORYL-RXN]]
+
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-13724]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00001581001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13282 RXN-13282]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13283 RXN-13283]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13284 RXN-13284]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13285 RXN-13285]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13291 RXN-13291]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13310 RXN-13310]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13311 RXN-13311]
 
== External links  ==
 
== External links  ==
* CAS : 34612-38-9
+
{{#set: common name=botryococcenes and methylated squalene biosynthesis}}
* METABOLIGHTS : MTBLC61988
+
{{#set: taxonomic range=TAX-38879}}
* PUBCHEM:
+
{{#set: common name=botryococcene hydrocarbon biosynthesis}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439639 439639]
+
{{#set: reaction found=2}}
* HMDB : HMDB01296
+
{{#set: total reaction=9}}
* LIGAND-CPD:
+
{{#set: completion rate=22.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C02052 C02052]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.393830.html 393830]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28460 28460]
+
* BIGG : maltttr
+
{{#set: smiles=C(C4(OC(OC3(C(OC(OC2(C(OC(OC1(C(OC(O)C(C1O)O)CO))C(C2O)O)CO))C(C3O)O)CO))C(C(O)C4O)O))O}}
+
{{#set: inchi key=InChIKey=LUEWUZLMQUOBSB-AYQJAVFRSA-N}}
+
{{#set: common name=maltotetraose}}
+
{{#set: molecular weight=666.583    }}
+
{{#set: consumed by=RXN0-5182|RXN-14260}}
+
{{#set: produced by=RXN-14281|AMYLOMALT-RXN|RXN-14284}}
+
{{#set: consumed or produced by=GLYMALTOPHOSPHORYL-RXN}}
+

Latest revision as of 15:50, 9 January 2019

Pathway PWY-6105

  • common name:
    • botryococcenes and methylated squalene biosynthesis
  • taxonomic range:
  • Synonym(s):
    • botryococcene hydrocarbon biosynthesis

Reaction(s) found

2 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links