Difference between revisions of "ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCDP DCDP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(=O)([O-])[O-])([O-])=O * i...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.6.1.13 EC-2.6.1.13] |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[2-Oxo-carboxylates]][c] '''+''' 1 [[L-ORNITHINE]][c] '''<=>''' 1 [[L-GLUTAMATE_GAMMA-SEMIALDEHYDE]][c] '''+''' 1 [[Amino-Acids-20]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 a 2-oxo carboxylate[c] '''+''' 1 L-ornithine[c] '''<=>''' 1 L-glutamate-5-semialdehyde[c] '''+''' 1 a proteinogenic amino acid[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | + | * Gene: [[CHC_T00002893001_1]] | |
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13877 13877] | |
− | + | * UNIPROT: | |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P31893 P31893] |
− | * | + | ** [http://www.uniprot.org/uniprot/P38021 P38021] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9P7L5 Q9P7L5] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P07991 P07991] |
− | * | + | ** [http://www.uniprot.org/uniprot/P04181 P04181] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P29758 P29758] |
− | * | + | ** [http://www.uniprot.org/uniprot/P04182 P04182] |
− | ** [http://www. | + | * LIGAND-RXN: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01343 R01343] |
− | {{#set: | + | {{#set: direction=REVERSIBLE}} |
− | {{#set: | + | {{#set: ec number=EC-2.6.1.13}} |
− | {{#set: | + | {{#set: gene associated=CHC_T00002893001_1}} |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-ectocarpus_siliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 15:50, 9 January 2019
Contents
Reaction ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 2-Oxo-carboxylates[c] + 1 L-ORNITHINE[c] <=> 1 L-GLUTAMATE_GAMMA-SEMIALDEHYDE[c] + 1 Amino-Acids-20[c]
- With common name(s):
- 1 a 2-oxo carboxylate[c] + 1 L-ornithine[c] <=> 1 L-glutamate-5-semialdehyde[c] + 1 a proteinogenic amino acid[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00002893001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
External links