Difference between revisions of "CPD-8844"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ARGSPECAT-PWY ARGSPECAT-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8844 CPD-8844] == |
| − | * | + | * smiles: |
| − | ** | + | ** C=CC=C(CCC=C(C)C)C |
| − | ** | + | * molecular weight: |
| − | ** | + | ** 150.263 |
| + | * inchi key: | ||
| + | ** InChIKey=LUKZREJJLWEWQM-YRNVUSSQSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** (3E)-4,8-dimethylnona-1,3,7-triene |
* Synonym(s): | * Synonym(s): | ||
| + | ** (3E)-4,8-dimethyl-1,3,7-nonatriene | ||
| + | ** 4,8-dimethyl-1,3(E),7-nonatriene | ||
| + | ** DMNT | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | ** [[ | + | * [[RXN-11911]] |
| − | == Reaction(s) | + | * [[RXN-8619]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * CHEBI: |
| − | ** [http:// | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60158 60158] |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6427110 6427110] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: common name= | + | ** [http://www.chemspider.com/Chemical-Structure.4932528.html 4932528] |
| − | {{#set: | + | * HMDB : HMDB35792 |
| − | {{#set: | + | {{#set: smiles=C=CC=C(CCC=C(C)C)C}} |
| + | {{#set: molecular weight=150.263 }} | ||
| + | {{#set: inchi key=InChIKey=LUKZREJJLWEWQM-YRNVUSSQSA-N}} | ||
| + | {{#set: common name=(3E)-4,8-dimethylnona-1,3,7-triene}} | ||
| + | {{#set: common name=(3E)-4,8-dimethyl-1,3,7-nonatriene|4,8-dimethyl-1,3(E),7-nonatriene|DMNT}} | ||
| + | {{#set: produced by=RXN-11911|RXN-8619}} | ||
Latest revision as of 15:51, 9 January 2019
Contents
Metabolite CPD-8844
- smiles:
- C=CC=C(CCC=C(C)C)C
- molecular weight:
- 150.263
- inchi key:
- InChIKey=LUKZREJJLWEWQM-YRNVUSSQSA-N
- common name:
- (3E)-4,8-dimethylnona-1,3,7-triene
- Synonym(s):
- (3E)-4,8-dimethyl-1,3,7-nonatriene
- 4,8-dimethyl-1,3(E),7-nonatriene
- DMNT
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
