Difference between revisions of "CPD-11700"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SO3 SO3] == * smiles: ** [O-]S([O-])=O * inchi key: ** InChIKey=LSNNMFCWUKXFEE-UHFFFAOYSA-L * c...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11700 CPD-11700] == |
* smiles: | * smiles: | ||
− | ** [O-] | + | ** C1(OP(=O)([O-])[O-])(C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)C(OP(=O)([O-])[O-])1) |
+ | * molecular weight: | ||
+ | ** 726.913 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=UPHPWXPNZIOZJL-UOTPTPDRSA-A |
* common name: | * common name: | ||
− | ** | + | ** 1D-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 1-diphosinositol pentakisphosphate |
− | ** | + | ** iphospho-myo-inositol pentakisphosphate |
+ | ** 1D-myo-inositol 1-diphosphate pentakisphosphate | ||
+ | ** 1-diphospho-1D-myo-inositol 2,3,4,5,6-pentakisphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-10974]] | |
− | * [[RXN- | + | |
− | + | ||
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74946 74946] |
− | * | + | * PUBCHEM: |
− | {{#set: smiles=[O-] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237379 44237379] |
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11174 C11174] |
− | {{#set: | + | * HMDB : HMDB12494 |
− | {{#set: common name= | + | {{#set: smiles=C1(OP(=O)([O-])[O-])(C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)C(OP(=O)([O-])[O-])1)}} |
− | {{#set: | + | {{#set: molecular weight=726.913 }} |
− | + | {{#set: inchi key=InChIKey=UPHPWXPNZIOZJL-UOTPTPDRSA-A}} | |
− | {{#set: consumed | + | {{#set: common name=1D-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate}} |
+ | {{#set: common name=1-diphosinositol pentakisphosphate|iphospho-myo-inositol pentakisphosphate|1D-myo-inositol 1-diphosphate pentakisphosphate|1-diphospho-1D-myo-inositol 2,3,4,5,6-pentakisphosphate}} | ||
+ | {{#set: consumed by=RXN-10974}} |
Latest revision as of 16:51, 9 January 2019
Contents
Metabolite CPD-11700
- smiles:
- C1(OP(=O)([O-])[O-])(C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)C(OP(=O)([O-])[O-])1)
- molecular weight:
- 726.913
- inchi key:
- InChIKey=UPHPWXPNZIOZJL-UOTPTPDRSA-A
- common name:
- 1D-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate
- Synonym(s):
- 1-diphosinositol pentakisphosphate
- iphospho-myo-inositol pentakisphosphate
- 1D-myo-inositol 1-diphosphate pentakisphosphate
- 1-diphospho-1D-myo-inositol 2,3,4,5,6-pentakisphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(OP(=O)([O-])[O-])(C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)C(OP(=O)([O-])[O-])1)" cannot be used as a page name in this wiki.