Difference between revisions of "PWY-7666"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYINOSINE DEOXYINOSINE] == * smiles: ** C(O)C1(OC(CC(O)1)N3(C=NC2(=C(O)N=CN=C23))) * inchi k...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYINOSINE DEOXYINOSINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7666 PWY-7666] ==
* smiles:
+
** C(O)C1(OC(CC(O)1)N3(C=NC2(=C(O)N=CN=C23)))
+
* inchi key:
+
** InChIKey=VGONTNSXDCQUGY-RRKCRQDMSA-N
+
 
* common name:
 
* common name:
** 2'-deoxyinosine
+
** galactolipid biosynthesis II
* molecular weight:
+
* taxonomic range:
** 252.229   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
 
* Synonym(s):
 
* Synonym(s):
** deoxyinosine
+
** galactosylglyceride biosynthesis II
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''3''' reactions in the full pathway
* [[ADDALT-RXN]]
+
* [[RXN-1225]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[CHC_T00008344001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16647 RXN-16647]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16648 RXN-16648]
 
== External links  ==
 
== External links  ==
* CAS : 890-38-0
+
{{#set: common name=galactolipid biosynthesis II}}
* METABOLIGHTS : MTBLC28997
+
{{#set: taxonomic range=TAX-1117}}
* PUBCHEM:
+
{{#set: common name=galactosylglyceride biosynthesis II}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65058 65058]
+
{{#set: reaction found=1}}
* HMDB : HMDB00071
+
{{#set: total reaction=3}}
* LIGAND-CPD:
+
{{#set: completion rate=33.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C05512 C05512]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.619.html 619]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28997 28997]
+
* BIGG : din
+
{{#set: smiles=C(O)C1(OC(CC(O)1)N3(C=NC2(=C(O)N=CN=C23)))}}
+
{{#set: inchi key=InChIKey=VGONTNSXDCQUGY-RRKCRQDMSA-N}}
+
{{#set: common name=2'-deoxyinosine}}
+
{{#set: molecular weight=252.229    }}
+
{{#set: common name=deoxyinosine}}
+
{{#set: produced by=ADDALT-RXN}}
+

Latest revision as of 15:53, 9 January 2019

Pathway PWY-7666

  • common name:
    • galactolipid biosynthesis II
  • taxonomic range:
  • Synonym(s):
    • galactosylglyceride biosynthesis II

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links