Difference between revisions of "CPD-6702"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1722 PWY-1722] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) |
| − | ** | + | * molecular weight: |
| − | ** | + | ** 258.121 |
| + | * inchi key: | ||
| + | ** InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** 1D-myo-inositol 6-monophosphate |
* Synonym(s): | * Synonym(s): | ||
| + | ** Ins(6)P1 | ||
| + | ** 1D-myo-inositol 6-phosphate | ||
| + | ** Ins(6)P | ||
| + | ** Ins6P | ||
| + | ** D-myo-inositol 6-monophosphate | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-10954]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64841 64841] |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203035 25203035] |
| − | {{#set: | + | {{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)}} |
| − | {{#set: | + | {{#set: molecular weight=258.121 }} |
| + | {{#set: inchi key=InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L}} | ||
| + | {{#set: common name=1D-myo-inositol 6-monophosphate}} | ||
| + | {{#set: common name=Ins(6)P1|1D-myo-inositol 6-phosphate|Ins(6)P|Ins6P|D-myo-inositol 6-monophosphate}} | ||
| + | {{#set: consumed by=RXN-10954}} | ||
Latest revision as of 16:54, 9 January 2019
Contents
Metabolite CPD-6702
- smiles:
- C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)
- molecular weight:
- 258.121
- inchi key:
- InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L
- common name:
- 1D-myo-inositol 6-monophosphate
- Synonym(s):
- Ins(6)P1
- 1D-myo-inositol 6-phosphate
- Ins(6)P
- Ins6P
- D-myo-inositol 6-monophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)" cannot be used as a page name in this wiki.
