Difference between revisions of "SOLANESYL-PYROPHOSPHATE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALKANE-1-MONOOXYGENASE-RXN ALKANE-1-MONOOXYGENASE-RXN] == * direction: ** LEFT-TO-RIGHT * common na...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SOLANESYL-PYROPHOSPHATE SOLANESYL-PYROPHOSPHATE] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] |
+ | * molecular weight: | ||
+ | ** 788.015 | ||
+ | * inchi key: | ||
+ | ** InChIKey=IVLBHBFTRNVIAP-MEGGAXOGSA-K | ||
* common name: | * common name: | ||
− | ** | + | ** all-trans-nonaprenyl diphosphate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** solanyl pyrophosphate | ||
+ | ** solanesyl diphosphate | ||
+ | ** (hydroxy-(3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenoxy)phosphinoyl)oxyphosphonic acid | ||
+ | ** solanesyl pyrophosphate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[2.5.1.39-RXN]] |
− | + | * [[RXN-2761]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-11486]] | |
− | + | * [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58391 58391] |
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244603 25244603] |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04145 C04145] | |
− | * | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]}} |
− | ** [http://www. | + | {{#set: molecular weight=788.015 }} |
− | {{#set: | + | {{#set: inchi key=InChIKey=IVLBHBFTRNVIAP-MEGGAXOGSA-K}} |
− | {{#set: | + | {{#set: common name=all-trans-nonaprenyl diphosphate}} |
− | + | {{#set: common name=solanyl pyrophosphate|solanesyl diphosphate|(hydroxy-(3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenoxy)phosphinoyl)oxyphosphonic acid|solanesyl pyrophosphate}} | |
− | {{#set: | + | {{#set: consumed by=2.5.1.39-RXN|RXN-2761}} |
− | + | {{#set: produced by=RXN-11486|TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 15:55, 9 January 2019
Contents
Metabolite SOLANESYL-PYROPHOSPHATE
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]
- molecular weight:
- 788.015
- inchi key:
- InChIKey=IVLBHBFTRNVIAP-MEGGAXOGSA-K
- common name:
- all-trans-nonaprenyl diphosphate
- Synonym(s):
- solanyl pyrophosphate
- solanesyl diphosphate
- (hydroxy-(3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenoxy)phosphinoyl)oxyphosphonic acid
- solanesyl pyrophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-" cannot be used as a page name in this wiki.