Difference between revisions of "PWY-5076"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] == * smiles: ** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2)) * inchi key...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5076 PWY-5076] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-leucine degradation III |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** Ehrlich pathway |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''3''' reactions found over '''3''' reactions in the full pathway |
| − | + | * [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]] | |
| − | * [[RXN- | + | ** 1 associated gene(s): |
| − | == Reaction(s) | + | *** [[CHC_T00003864001_1]] |
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[RXN-7692]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
| + | * [[RXN-7693]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[CHC_T00010066001_1]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=L-leucine degradation III}} | |
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: common name=Ehrlich pathway}} | |
| − | + | {{#set: reaction found=3}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 15:55, 9 January 2019
Pathway PWY-5076
- common name:
- L-leucine degradation III
- taxonomic range:
- Synonym(s):
- Ehrlich pathway
Reaction(s) found
3 reactions found over 3 reactions in the full pathway
- BRANCHED-CHAINAMINOTRANSFERLEU-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-7692
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-7693
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
