Difference between revisions of "PWY-6837"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3) * inchi ke...") |
|||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6837 PWY-6837] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** ( | + | ** fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent) |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''3''' reactions found over '''5''' reactions in the full pathway | |
− | * [[RXN- | + | * [[RXN-12518]] |
− | == Reaction(s) | + | ** 10 associated gene(s): |
+ | *** [[CHC_T00009142001_1]] | ||
+ | *** [[CHC_T00008478001_1]] | ||
+ | *** [[CHC_T00008935001_1]] | ||
+ | *** [[CHC_T00009531001_1]] | ||
+ | *** [[CHC_T00007910001_1]] | ||
+ | *** [[CHC_T00008400001]] | ||
+ | *** [[CHC_T00009531001]] | ||
+ | *** [[CHC_T00009142001]] | ||
+ | *** [[CHC_T00008400001_1]] | ||
+ | *** [[CHC_T00008935001]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RXN-12519]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00009422001_1]] | ||
+ | *** [[CHC_T00009349001_1]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | * [[RXN-7836]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00009422001_1]] | ||
+ | *** [[CHC_T00009349001_1]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12520 RXN-12520] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12521 RXN-12521] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent)}} | |
− | + | {{#set: taxonomic range=TAX-33154}} | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=60.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:55, 9 January 2019
Pathway PWY-6837
- common name:
- fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent)
- taxonomic range:
- Synonym(s):
Reaction(s) found
3 reactions found over 5 reactions in the full pathway
- RXN-12518
- 10 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-12519
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-7836
- 2 associated gene(s):
- 1 reconstruction source(s) associated: