Difference between revisions of "PWY-6837"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3) * inchi ke...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6837 PWY-6837] ==
* smiles:
+
** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3)
+
* inchi key:
+
** InChIKey=URFCJEUYXNAHFI-ZDUSSCGKSA-M
+
 
* common name:
 
* common name:
** (2S)-pinocembrin
+
** fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent)
* molecular weight:
+
* taxonomic range:
** 255.249   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''5''' reactions in the full pathway
* [[RXN-7647]]
+
* [[RXN-12518]]
== Reaction(s) of unknown directionality ==
+
** 10 associated gene(s):
 +
*** [[CHC_T00009142001_1]]
 +
*** [[CHC_T00008478001_1]]
 +
*** [[CHC_T00008935001_1]]
 +
*** [[CHC_T00009531001_1]]
 +
*** [[CHC_T00007910001_1]]
 +
*** [[CHC_T00008400001]]
 +
*** [[CHC_T00009531001]]
 +
*** [[CHC_T00009142001]]
 +
*** [[CHC_T00008400001_1]]
 +
*** [[CHC_T00008935001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-12519]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009422001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN-7836]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009422001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12520 RXN-12520]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12521 RXN-12521]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPK12140214
+
{{#set: common name=fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent)}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33154}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200438 25200438]
+
{{#set: taxonomic range=TAX-33090}}
* HMDB : HMDB30808
+
{{#set: reaction found=3}}
* LIGAND-CPD:
+
{{#set: total reaction=5}}
** [http://www.genome.jp/dbget-bin/www_bget?C09827 C09827]
+
{{#set: completion rate=60.0}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28157 28157]
+
* METABOLIGHTS : MTBLC28157
+
{{#set: smiles=C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3)}}
+
{{#set: inchi key=InChIKey=URFCJEUYXNAHFI-ZDUSSCGKSA-M}}
+
{{#set: common name=(2S)-pinocembrin}}
+
{{#set: molecular weight=255.249    }}
+
{{#set: produced by=RXN-7647}}
+

Latest revision as of 16:55, 9 January 2019

Pathway PWY-6837

  • common name:
    • fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent)
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

3 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links