Difference between revisions of "PWY-5938"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-]...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5938 PWY-5938] ==
* smiles:
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
+
* inchi key:
+
** InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
+
 
* common name:
 
* common name:
** 4α-carboxy-5α-cholesta-8-en-3β-ol
+
** (R)-acetoin biosynthesis I
* molecular weight:
+
* taxonomic range:
** 429.662   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
 +
** D-acetoin biosynthesis I
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN66-23]]
+
'''1''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ACETOLACTSYN-RXN]]
* [[RXN-13710]]
+
** 3 associated gene(s):
* [[RXN66-22]]
+
*** [[CHC_T00002409001_1]]
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00008160001_1]]
 +
*** [[CHC_980]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11036 RXN-11036]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6081 RXN-6081]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=(R)-acetoin biosynthesis I}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826593 91826593]
+
{{#set: taxonomic range=TAX-4751}}
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87055 87055]
+
{{#set: common name=D-acetoin biosynthesis I}}
* HMDB : HMDB12166
+
{{#set: reaction found=1}}
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C}}
+
{{#set: total reaction=3}}
{{#set: inchi key=InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M}}
+
{{#set: completion rate=33.0}}
{{#set: common name=4α-carboxy-5α-cholesta-8-en-3β-ol}}
+
{{#set: molecular weight=429.662    }}
+
{{#set: consumed by=RXN66-23}}
+
{{#set: produced by=RXN-13710|RXN66-22}}
+

Latest revision as of 16:56, 9 January 2019

Pathway PWY-5938

  • common name:
    • (R)-acetoin biosynthesis I
  • taxonomic range:
  • Synonym(s):
    • D-acetoin biosynthesis I

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links