|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CITSYN-RXN CITSYN-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PORPHOBILINOGEN PORPHOBILINOGEN] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C(C1(=C(C(=CN1)CCC(=O)[O-])CC(=O)[O-]))[N+] |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/2.3.3.16 EC-2.3.3.16] | + | ** 225.224 |
− | ** [http://enzyme.expasy.org/EC/2.3.3.1 EC-2.3.3.1] | + | * inchi key: |
| + | ** InChIKey=QSHWIQZFGQKFMA-UHFFFAOYSA-M |
| + | * common name: |
| + | ** porphobilinogen |
| * Synonym(s): | | * Synonym(s): |
− | ** Condensing enzyme
| |
− | ** citrate synthesis
| |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[OHMETHYLBILANESYN-RXN]] |
− | ** 1 [[WATER]][c] '''+''' 1 [[OXALACETIC_ACID]][c] '''+''' 1 [[ACETYL-COA]][c] '''=>''' 1 [[CIT]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CO-A]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | * [[PORPHOBILSYNTH-RXN]] |
− | ** 1 H2O[c] '''+''' 1 oxaloacetate[c] '''+''' 1 acetyl-CoA[c] '''=>''' 1 citrate[c] '''+''' 1 H+[c] '''+''' 1 coenzyme A[c]
| + | == Reaction(s) of unknown directionality == |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[CHC_T00007817001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | == Pathways ==
| + | |
− | * [[FERMENTATION-PWY]], mixed acid fermentation: [http://metacyc.org/META/NEW-IMAGE?object=FERMENTATION-PWY FERMENTATION-PWY]
| + | |
− | ** '''11''' reactions found over '''16''' reactions in the full pathway
| + | |
− | * [[PWY-5750]], itaconate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5750 PWY-5750]
| + | |
− | ** '''2''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-5913]], partial TCA cycle (obligate autotrophs): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913]
| + | |
− | ** '''10''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[REDCITCYC]], TCA cycle VIII (helicobacter): [http://metacyc.org/META/NEW-IMAGE?object=REDCITCYC REDCITCYC] | + | |
− | ** '''5''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-7124]], ethylene biosynthesis V (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7124 PWY-7124]
| + | |
− | ** '''8''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[P105-PWY]], TCA cycle IV (2-oxoglutarate decarboxylase): [http://metacyc.org/META/NEW-IMAGE?object=P105-PWY P105-PWY]
| + | |
− | ** '''8''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[GLYOXYLATE-BYPASS]], glyoxylate cycle: [http://metacyc.org/META/NEW-IMAGE?object=GLYOXYLATE-BYPASS GLYOXYLATE-BYPASS]
| + | |
− | ** '''4''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-6969]], TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6969 PWY-6969]
| + | |
− | ** '''8''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[PWY-6728]], methylaspartate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6728 PWY-6728]
| + | |
− | ** '''9''' reactions found over '''18''' reactions in the full pathway
| + | |
− | * [[PWY-6549]], L-glutamine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6549 PWY-6549]
| + | |
− | ** '''9''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-7254]], TCA cycle VII (acetate-producers): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7254 PWY-7254] | + | |
− | ** '''7''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-5690]], TCA cycle II (plants and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5690 PWY-5690]
| + | |
− | ** '''9''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY66-398]], TCA cycle III (animals): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-398 PWY66-398]
| + | |
− | ** '''10''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[TCA]], TCA cycle I (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=TCA TCA]
| + | |
− | ** '''9''' reactions found over '''10''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[galdieria.sulphuraria]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * METABOLIGHTS : MTBLC58126 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16845 16845] | + | * BIGG : ppbng |
− | * LIGAND-RXN: | + | * CAS : 487-90-1 |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00351 R00351]
| + | * HMDB : HMDB00245 |
− | * PIR:
| + | * CHEMSPIDER: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A43936 A43936]
| + | ** [http://www.chemspider.com/Chemical-Structure.5296496.html 5296496] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A81200 A81200] | + | * CHEBI: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=B81139 B81139] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58126 58126] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=E64760 E64760] | + | * LIGAND-CPD: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=F86708 F86708]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00931 C00931] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=G69600 G69600] | + | * PUBCHEM: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=G81265 G81265] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6921588 6921588] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I39506 I39506]
| + | {{#set: smiles=C(C1(=C(C(=CN1)CCC(=O)[O-])CC(=O)[O-]))[N+]}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I40044 I40044]
| + | {{#set: molecular weight=225.224 }} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I40380 I40380] | + | {{#set: inchi key=InChIKey=QSHWIQZFGQKFMA-UHFFFAOYSA-M}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I40717 I40717]
| + | {{#set: common name=porphobilinogen}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JQ1392 JQ1392] | + | {{#set: consumed by=OHMETHYLBILANESYN-RXN}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=PQ0046 PQ0046] | + | {{#set: produced by=PORPHOBILSYNTH-RXN}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S41527 S41527] | + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S41563 S41563]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S42370 S42370]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S44316 S44316]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S52814 S52814]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T02390 T02390]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T09334 T09334]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T44615 T44615]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKBY YKBY]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKBYC YKBYC]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKEC YKEC]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKMUM YKMUM]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKMY YKMY]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKPG YKPG]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKPSCA YKPSCA]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKQPC YKQPC]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKRECP YKRECP]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=YKYT YKYT]
| + | |
− | * UNIPROT:
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JRA5 Q9JRA5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JQX0 Q9JQX0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31660 P31660]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CHQ6 Q9CHQ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39120 P39120]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PLZ5 Q9PLZ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20902 P20902]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51033 P51033]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39119 P39119]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42457 P42457]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18789 P18789]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20903 P20903]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51038 P51038]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34085 P34085]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34575 P34575]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43175 Q43175]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43635 P43635]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24259 O24259]
| + | |
− | ** [http://www.uniprot.org/uniprot/O32705 O32705]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00890 P00890]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08679 P08679]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0ABH7 P0ABH7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q47237 Q47237]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20115 P20115]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26491 P26491]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00889 P00889]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20901 P20901]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09948 P09948]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21553 P21553]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}}
| + | |
− | {{#set: ec number=EC-2.3.3.16}} | + | |
− | {{#set: ec number=EC-2.3.3.1}} | + | |
− | {{#set: common name=Condensing enzyme|citrate synthesis}} | + | |
− | {{#set: gene associated=CHC_T00007817001_1}} | + | |
− | {{#set: in pathway=FERMENTATION-PWY|PWY-5750|PWY-5913|REDCITCYC|PWY-7124|P105-PWY|GLYOXYLATE-BYPASS|PWY-6969|PWY-6728|PWY-6549|PWY-7254|PWY-5690|PWY66-398|TCA}} | + | |
− | {{#set: reconstruction category=orthology}}
| + | |
− | {{#set: reconstruction tool=pantograph}}
| + | |
− | {{#set: reconstruction source=galdieria.sulphuraria}}
| + | |